Homework Answers
Ionisation of water forms hydroxide ion (OH-) and proton (H+).
So,
H2O(l) 
H+(aq)+OH-(aq) is right answer.
Add Answer to:
Which of the following chemical reactions represents the ionization of water? 0 H2O(l) H2O+(aq) + e-...
Which of the following reactions has a net lonic equation of H^+ (aq)+OH^- (aq)-> H20(l) a)...
Which of the following reactions has a net lonic equation of H^+ (aq)+OH^- (aq)-> H20(l) a) 2NaOH(s)+CO2(g)-> Na2CO3 (s)+ H2O (l) b) NH3 (aq)+H2O(l)-> NH4OH(aq) c) KOH(aq)+ HClO4 (aq)-> H2O (l) +KClO4 (aq) d) MgH2 (s)+ 2H2O (l)->2H2(g)+Mg(OH)2 (aq) e) none of the above
24. Which of the following chemical equations corresponds to Kay of phosphoric acid? a. HPO (aq) + H2O(l) = PO (aq)...
24. Which of the following chemical equations corresponds to Kay of phosphoric acid? a. HPO (aq) + H2O(l) = PO (aq) + H2O (aq) b. PO2 (aq) + H2O(1) HPO2 (aq) + OH(aq) c. H,PO(aq) + H2000) H2PO4 (aq) + H,O'(aq) d. H3PO4(aq) + 2 H2O(l) =HPO2 (aq) + 2 H20 (aq) e. H2PO4 (aq) + H2O(1) HPO2 (aq) + H:0 (aq) 25. Which of the following chemical equations corresponds to K for SO 22
Which of the following reactions is a redox reaction? (A) NH3(g) + H2O(l) NH4OH(aq) (B) 2...
Which of the following reactions is a redox reaction? (A) NH3(g) + H2O(l) NH4OH(aq) (B) 2 H2O(l) → H30* (aq) + OH- (aq) (C) Mg(OH)2(s) Mg* (aq) + 2 OH- (aq) (E) CO(g) + H2O(g) + CO2(g) + H2(g) (E) 3 HCl(aq) + Na3PO4(aq) H3PO4(aq) + 3 NaCl(aq)
Question 16 Which of the following reactions represents the disproportionation of chlorine in water? C12(g) +H30(7)=CH(aq)...
Question 16 Which of the following reactions represents the disproportionation of chlorine in water? C12(g) +H30(7)=CH(aq) + HCl(aq) + OH(aq) Cl2(g) + H2O(1)=CH(aq) +H+ (aq) + HClO(aq) Cl2(g) + H2O(1) CH(aq) + H2(g) + Clo+(aq) Cl2(g) + 2H2O(1) Cl(aq) + 3H*(aq) + HClO3(aq) Cl2(g) + 4H2O(1 =CH(aq) + SH*(aq)-C10:"(aq)
Consider the following reactions: SO32- (aq) + H2O(l) = HSO3_(aq) + OH-(aq) Kb1 = 8.3 x...
Consider the following reactions: SO32- (aq) + H2O(l) = HSO3_(aq) + OH-(aq) Kb1 = 8.3 x 10-8 | HSO3- (aq) + H2O(l) = H2SO3(aq) + OH-(aq) K12 = 7.6 x 10-13 What is the pH of 1.0 x 10-3 M Na2SO3? Select one: O a. 5.0 O b. 10.5 C. 13.0 O d. 9.0 e. 7.0
14. Which of the following chemical equations corresponds to the acid ionization constant, K., for benzoic...
14. Which of the following chemical equations corresponds to the acid ionization constant, K., for benzoic acid (CHECO,HD)? CHỤCO (aq) + HO'(aq) CICOH + H2 b. CH.COH(aq) + H C H.CO. (aq) + H.O'(aq) c. CH.CO.H(aq) + OH(aq) = CH.CO. (aq) +HOD) d. CH.CO.H(aq) + H2O (aq) C.H.CO,H;" (aq) + H2O(!) e. C.H.CO, (aq) + H.0(0)= C.H.CO,H(aq) + OH(aq)
8) AS is negative for the reaction A) C6H1206 (s) - 6C (s) + 6H2 (g)+302 (g) B) CH30H (I)-CH30H (g) C) Sr(NO3)2 (aq) 2LiOH (aq) Sr(OH)2 (s)+ 2LiNO3 (aq) D) LiOH (aq) Li+ (aq)+OH-(aq) E) 2H2...
8) AS is negative for the reaction A) C6H1206 (s) - 6C (s) + 6H2 (g)+302 (g) B) CH30H (I)-CH30H (g) C) Sr(NO3)2 (aq) 2LiOH (aq) Sr(OH)2 (s)+ 2LiNO3 (aq) D) LiOH (aq) Li+ (aq)+OH-(aq) E) 2H20 (g) 2H2 (g) 02 (8) (Sec. 19.4)
8) AS is negative for the reaction A) C6H1206 (s) - 6C (s) + 6H2 (g)+302 (g) B) CH30H (I)-CH30H (g) C) Sr(NO3)2 (aq) 2LiOH (aq) Sr(OH)2 (s)+ 2LiNO3 (aq) D) LiOH (aq) Li+ (aq)+OH-(aq) E)...
Given the following reduction half-reactions: Fe3+(aq)+e−→Fe2+(aq) E∘red=+0.77V S2O2−6(aq)+4H+(aq)+2e−→2H2SO3(aq) E∘red=+0.60V N2O(g)+2H+(aq)+2e−→N2(g)+H2O(l) E∘red=−1.77V VO+2(aq)+2H+(aq)+e−→VO2+(aq)+H2O(l) E∘red=+1.00V Part A Write...
Given the following reduction half-reactions: Fe3+(aq)+e−→Fe2+(aq) E∘red=+0.77V S2O2−6(aq)+4H+(aq)+2e−→2H2SO3(aq) E∘red=+0.60V N2O(g)+2H+(aq)+2e−→N2(g)+H2O(l) E∘red=−1.77V VO+2(aq)+2H+(aq)+e−→VO2+(aq)+H2O(l) E∘red=+1.00V Part A Write balanced chemical equation for the oxidation of Fe2+(aq) by S2O2−6 (aq). Calculate the equilibrium constant K for this reaction at 298 K. Part B Write balanced chemical equation for the oxidation of Fe2+(aq) by N2O(g). Part C Write balanced chemical equation for the oxidation of Fe2+(aq) by VO+2(aq). Calculate the equilibrium constant K for this reaction at 298 K.
C6H4(OH)2(aq) + H2O2(aq) ----> C6H4O2(aq) + 2 H2O(l) Given the entropies of the reactions below, calculate...
C6H4(OH)2(aq) + H2O2(aq) ----> C6H4O2(aq) + 2 H2O(l) Given the entropies of the reactions below, calculate the entropy of the chemical explosion at 37 C. 2 H2O2 (aq) ------> 2H2O(l) +O2(g) = +0.4501 kj/mole*k C6H4((OH)2(aq) ------> C6H4O2(aq) + H2(g) = + 0.5033 kj/mole*k 2 H2(g) + O2(g) -----> 2 H2O (l) = -0.327.2 kj/mole*k
Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e-...
Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e- ----> Ni(OH)2(s)+H2O(l)+OH-(aq) Express the reduction as a chemical equation including phases and electrons.
24. Which of the following chemical equations corresponds to Kay of phosphoric acid? a. HPO (aq) + H2O(l) = PO (aq) + H2O (aq) b. PO2 (aq) + H2O(1) HPO2 (aq) + OH(aq) c. H,PO(aq) + H2000) H2PO4 (aq) + H,O'(aq) d. H3PO4(aq) + 2 H2O(l) =HPO2 (aq) + 2 H20 (aq) e. H2PO4 (aq) + H2O(1) HPO2 (aq) + H:0 (aq) 25. Which of the following chemical equations corresponds to K for SO 22
Which of the following reactions is a redox reaction? (A) NH3(g) + H2O(l) NH4OH(aq) (B) 2 H2O(l) → H30* (aq) + OH- (aq) (C) Mg(OH)2(s) Mg* (aq) + 2 OH- (aq) (E) CO(g) + H2O(g) + CO2(g) + H2(g) (E) 3 HCl(aq) + Na3PO4(aq) H3PO4(aq) + 3 NaCl(aq)
Question 16 Which of the following reactions represents the disproportionation of chlorine in water? C12(g) +H30(7)=CH(aq) + HCl(aq) + OH(aq) Cl2(g) + H2O(1)=CH(aq) +H+ (aq) + HClO(aq) Cl2(g) + H2O(1) CH(aq) + H2(g) + Clo+(aq) Cl2(g) + 2H2O(1) Cl(aq) + 3H*(aq) + HClO3(aq) Cl2(g) + 4H2O(1 =CH(aq) + SH*(aq)-C10:"(aq)
Consider the following reactions: SO32- (aq) + H2O(l) = HSO3_(aq) + OH-(aq) Kb1 = 8.3 x 10-8 | HSO3- (aq) + H2O(l) = H2SO3(aq) + OH-(aq) K12 = 7.6 x 10-13 What is the pH of 1.0 x 10-3 M Na2SO3? Select one: O a. 5.0 O b. 10.5 C. 13.0 O d. 9.0 e. 7.0
14. Which of the following chemical equations corresponds to the acid ionization constant, K., for benzoic acid (CHECO,HD)? CHỤCO (aq) + HO'(aq) CICOH + H2 b. CH.COH(aq) + H C H.CO. (aq) + H.O'(aq) c. CH.CO.H(aq) + OH(aq) = CH.CO. (aq) +HOD) d. CH.CO.H(aq) + H2O (aq) C.H.CO,H;" (aq) + H2O(!) e. C.H.CO, (aq) + H.0(0)= C.H.CO,H(aq) + OH(aq)
8) AS is negative for the reaction A) C6H1206 (s) - 6C (s) + 6H2 (g)+302 (g) B) CH30H (I)-CH30H (g) C) Sr(NO3)2 (aq) 2LiOH (aq) Sr(OH)2 (s)+ 2LiNO3 (aq) D) LiOH (aq) Li+ (aq)+OH-(aq) E) 2H20 (g) 2H2 (g) 02 (8) (Sec. 19.4)
8) AS is negative for the reaction A) C6H1206 (s) - 6C (s) + 6H2 (g)+302 (g) B) CH30H (I)-CH30H (g) C) Sr(NO3)2 (aq) 2LiOH (aq) Sr(OH)2 (s)+ 2LiNO3 (aq) D) LiOH (aq) Li+ (aq)+OH-(aq) E)...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 11 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 11 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 11 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 11 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 11 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 11 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 11 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 11 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 11 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 11 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 11 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 11 months ago