
3) State the two criteria that governs aromaticity? (3 pts) 4) Give the hybridization, shape, and...
Consider each of the compounds. 1) Draw a large, stable line-angle structure with the correct bond angles. 2) Draw all appropriate resonance structures and indicate the major contributor. 3) Indicate all lone pair electrons on the atom. 4) Indicate the hybridization under each atom other than H a) CH2=CHCH(.)CH3 b) CH2=CHCH2CH(+)OH c) CH3CO(-)CH2
Question 3 For the molecules/ions below, draw Lewis structures that obey the octet rule. Indicate any reasonable resonance structures, geometry, bond angles, and hybridization as indicated. Formula Lewis Structure CN- Bond angle Hybrid. of N Geometry: Bond angle Hybrid. of S Geometr - so2 HNO, CH is bonded to an O atom) Bond angles: H-0-N Hybrid. of N Co,2 Bond angle Hybrid. of C Geometry HCO2 ?? Bond angles H-C-O 0-C-0 Hybrid. of C - 81
CHM 2440 (SP 2018) 2 zsf the hybridization (sp, sp', sp.sp'd.sp'd, etc)of the cireled atoms in the structures below: (0.75 7. S pts, 0.25 pt each) CH3 CH Structure a: H3C Hybridization of the cireled oxygen is : of the circled carbon is CH3 Structure b: Hybridization of the circled (C-O) oxygen is of the circled carbon is , of the circled (CAC) oxygen is C CH2 Structure c Hybridization of the circled nitrogen isof the circled (N of the...
What is the hybridization of each C in these molecules? Describe the shape of each molecule. C1,C=0 hybridized. The molecular geometry is __ the CI-C-Cl bond angle is __ , and the The carbon atom is CI-C-O bond angle is ___ Drag and drop your selection from the following list to complete the answer: CIC EN The carbon atom is hybridized. The molecular geometry is and the CI-C-N bond angle is __ Drag and drop your selection from the following...
Name: Doom! CH3 Part 2: Isomers - Pairs of compounds. Structural Isomers: 1. Use your model kit and build both of these structure. CH3 CH3-CH2-CH2 CH3-CH-CHE A. B. 1 What is the molecular formula for compound A? What is the molecular formula for compound B? - Without breaking any bonds, is it possible to convert A into B? Would the two compounds have identical properties?! What is the IUPAC name for compound A? What is the IUPAC name for compound...
12 13 4 5 6 24- Which of the following molecules have resonance structures? a) NBr. b)N, d) CO, c) 0 25-What is the molecular geometry if you have 4 single bonds around the central atom and no lone pairs? I a) Bent b) Tetrahedral c) trigonal pyramidal d) linear 26- Using the following Lewis structure and 3-dimensional structure of CH,OH answer the following questions? H 3- Hybridization of Oxygen b- Hybridization of Carbon CH-C-O bond angle d-HO-C bond angle...
Q-6 (a) Identify the hybridization of carbon atoms numbered 1-6 in the structure below: (3 marks) CH 5 CH2 C 3 H3C 2 4 C CH2 (b) Construct the molecular orbital energy level diagram for second period small interaction heteronuclear diatomic molecule Li2 and calculate its bond order. (2 marks
Q-6 (a) Identify the hybridization of carbon atoms numbered 1-6 in the structure below: (3 marks) CH 5 CH2 C 3 H3C 2 4 C CH2 (b) Construct the molecular...
Molecule / Ion Skeleton Scratch Work Final Lewis Structure Counting Electrons 3-D Drawing Bond Angles, Sulfur Electron Groups & Geometries (around central atom) Single bonds Resonance Polarity trioxide Double bonds Triple bonds = Lone pairs e-groups c-group geometry: Bond Angle: Lone pairs Resonance Structures? Molecular shape: Polar? How many? Single bonds = Carbon dioxide Double bonds = Triple bonds - Lone pairs = e-groups = e-group geometry: Bond Angle: Lone pairs = Molecular shape: Polar? Resonance Structures? How many?
2). Consider the following intramolecular S2 reaction. no ♡ + HI A) (5 pts) Use the table of Bond Dissociation Enthalpies (at the back of the exam) to calculate the approximate ΔΗπη. B) (3 pts) Is the reaction endothermic or exothermic? Why? C) (6 pts) Draw the Reaction Energy Coordinate Diagram. Label the axes, reactant(s), product(s), transition state(s), intermediate(s), activation energy, and reaction enthalpy. D) (3 pts) In regards to entropy, would you expect the reaction to be favorable, or...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...