NiO2(s) + Cd(s) --> Ni(OH)2(s) + Cd(OH)2(s) They gave me this unbalanced equation and said that...
NiO2(s) + Cd(s) --> Ni(OH)2(s) + Cd(OH)2(s)
They gave me this unbalanced equation and said that it needs H2O to be balanced, but i could not get it. And i had to find the cell potential for it
Homework Answers
Add Answer to:
NiO2(s) + Cd(s) --> Ni(OH)2(s) + Cd(OH)2(s)
They gave me this unbalanced equation and said that...
A rechargeable nickel-cadmium (NiCd) battery contains the following half-reactions: NiO2 +2H2O(l)+2e– → Ni(OH)2 +2OH– E0 =0.49V...
A rechargeable nickel-cadmium (NiCd) battery contains the following half-reactions: NiO2 +2H2O(l)+2e– → Ni(OH)2 +2OH– E0 =0.49V Cd(OH)2 +2e– →Cd(s)+2OH– E0 =–0.81V a. What is the standard cell potential or voltage of this NiCd cell? b. Write the net chemical reaction in the direction of spontaneous reaction. Is cadmium oxidized or reduced? c. Write an expression for the reaction quotient Q. What is Q if the electrolyte concentrations are: [NiO2] = 1 M and [Cd(OH)2] = 0.01M and [Ni(OH)2] = 0.001...
1)What is the overall cell reaction of a galvanic cell employing the following half-reactions? NiO2(s) +...
1)What is the overall cell reaction of a galvanic cell employing the following half-reactions? NiO2(s) + 2H2O + 2e- ⇄ Ni(OH)2(s) + 2OH-(aq), E°NiO2= 0.49 V; Fe(OH)2(s) + 2e- ⇄ Fe(s) + 2OH-(aq), E°Fe(OH)2= − 0.88 V. A)NiO2(s) + 2Fe(s) + 2H2O → Ni(OH)2(s) + 2Fe(OH)2(s) B)NiO2(s) + Fe(s) + 2H2O → Ni(OH)2(aq) + Fe(OH)2(aq) C)NiO2(s) + Fe(s) + 2H2O → Ni(OH)2(s) + Fe(OH)2(s) D)Ni(OH)2(s) + Fe(OH)2(s) → NiO2(s) + Fe(s) + 2H2O 2)What is the standard cell potential of...
Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e-...
Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e- ----> Ni(OH)2(s)+H2O(l)+OH-(aq) Express the reduction as a chemical equation including phases and electrons.
2. Balance the following chemical reaction in basic conditions using the lowest possible whole number coefficients....
2. Balance the following chemical reaction in basic conditions using the lowest possible whole number coefficients. (Enter coefficients for one and zero- blanks will be marked incorrect.) Unbalanced Reaction: ClO4−(aq) + Ni(OH)2(s) → ClO3−(aq) + NiO2(s) Balanced Reaction: ClO4−(aq) + Ni(OH)2(s) + H2O(l) + OH−(aq) + H+(aq) → ClO3−(aq) + NiO2(s) + H2O(l) + OH−(aq) + H+(aq) Incorrect. Tries 1/13 Previous Tries
Ni(OH)2 + NO3- _______> NiO2 + NO2- + H2O In the above redox reaction, use oxidation numbers to identify the...
Ni(OH)2 + NO3- _______> NiO2 + NO2- + H2O In the above redox reaction, use oxidation numbers to identify the element oxidized, the element reduced, the oxidizing agent and the reducing agent. name of the element oxidized: name of the element reduced: formula of the oxidizing agent: formula of the reducing agent:
Al3 (aq) + Ni(s). 3. Consider the unbalanced reaction Al(s)+ Ni2 (aq) > a. write balanced...
Al3 (aq) + Ni(s). 3. Consider the unbalanced reaction Al(s)+ Ni2 (aq) > a. write balanced cathode half reaction b. write the balanced anode half reaction C. Write the balanced overall reaction d. Calculate E。, the cell potential. Is the reaction spontaneous as written? e Calculate Eolf [AP ] = 4.00 M, [Ni2+] = 2.00 x 10-5 M.
Consider the following unbalanced equation: H3PO4(aq) + Ca(OH)2(s) → H2O(l) + Ca3(PO4)2(s) If 34.1 moles of...
Consider the following unbalanced equation: H3PO4(aq) + Ca(OH)2(s) → H2O(l) + Ca3(PO4)2(s) If 34.1 moles of H3PO4(aq) reacts with an excess of Ca(OH)2(s), what is the theoretical yield of H2O(l) in moles? O 6.34x102 moles 6.42x102 moles 1.02x102 moles 8.34x102 moles 8.37x102 moles 0 O
1. Will Cd + Zn2+ react? 2. Is Ni(OH)2 soluble in H2O? 3. Propane burns according...
1. Will Cd + Zn2+ react? 2. Is Ni(OH)2 soluble in H2O? 3. Propane burns according to the following equation: C3H8 + 5O2 3CO2 + 4H2O How many grams of CO2 can form from 0.177 mol of propane? 4. Cinnamic acid is 72.96% carbon, 5.40% hydrogen, and the rest is oxygen. What is the empirical formula of this acid?
NiCad battery: Ca(OH)2 (s) + 2 eCd (s) + 2 OH- (aq) E° = -0.40 V...
NiCad battery: Ca(OH)2 (s) + 2 eCd (s) + 2 OH- (aq) E° = -0.40 V 2 NiOOH (s) + 2 H2O () + 2 e + 2 Ni(OH)2 (s) + 2 OH- (aq) E° = 1.32 V Calculate the cell potential, Eºcell, using the formula Eºcell = Eºcathode - E°anode. Include the correct unit. Answer: Check
Write a balanced equation from the following cell notation: Mn(s) | Mn^2+ (aq) || CD^2+ (aq)...
Write a balanced equation from the following cell notation: Mn(s) | Mn^2+ (aq) || CD^2+ (aq) | Cd(s) Include the physical state of each reactant and product.
Al3 (aq) + Ni(s). 3. Consider the unbalanced reaction Al(s)+ Ni2 (aq) > a. write balanced cathode half reaction b. write the balanced anode half reaction C. Write the balanced overall reaction d. Calculate E。, the cell potential. Is the reaction spontaneous as written? e Calculate Eolf [AP ] = 4.00 M, [Ni2+] = 2.00 x 10-5 M.
Consider the following unbalanced equation: H3PO4(aq) + Ca(OH)2(s) → H2O(l) + Ca3(PO4)2(s) If 34.1 moles of H3PO4(aq) reacts with an excess of Ca(OH)2(s), what is the theoretical yield of H2O(l) in moles? O 6.34x102 moles 6.42x102 moles 1.02x102 moles 8.34x102 moles 8.37x102 moles 0 O
NiCad battery: Ca(OH)2 (s) + 2 eCd (s) + 2 OH- (aq) E° = -0.40 V 2 NiOOH (s) + 2 H2O () + 2 e + 2 Ni(OH)2 (s) + 2 OH- (aq) E° = 1.32 V Calculate the cell potential, Eºcell, using the formula Eºcell = Eºcathode - E°anode. Include the correct unit. Answer: Check
Write a balanced equation from the following cell notation: Mn(s) | Mn^2+ (aq) || CD^2+ (aq) | Cd(s) Include the physical state of each reactant and product.
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago