What type of a compound is CH3CH2CH2CH(OH)CH2CH3? |
Which compound would have the highest boiling point?
CH3CH2CH2CH2–OH
CH3CH2–O–CH2CH3
CH3-O–CH2CH2CH3
он CH3CH2-CH-OH
What type of compound does this represent? H-C=0 H-C-OH H-C-OH CH OH ketotriose ketotetrose aldotriose aldotetrose < Next >
Which of the following is a tertiary alcohol? CH3CH2-CH-CH2CH2CH3 CH2CH2CH2OH CH3CH2-CH-CH3 OH CH2CH2CH3 CH3 CH2-C-CH2CH3 OH LOH CH2CH3 Reset Selection Type here to search
In our TLC system, which compound is more likely to be at the solvent front: 1 or 2. CH3CH2CH2CH=O CH3CH2CH2CH3
Part B What is the IUPAC name for the following compound? CH CH2CH2CH, CH2CH3
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....
Draw a structural formula of the SS configuration of the compound shown below. Is CH₂ CH2CH3 OH • Use the wedge hash bond tools to indicate stereochemistry where it exists. • Include H atoms at chiral centers only. • If a group is achiral, do not use wedged or hashed bonds on it.
H2SO4 (catalytic) heat 2 + OH attack ortho to OH & para to X xanthene type dye: X = OH (fluorescein) X = N(CH2CH3)2 (rhodamine B) I What is the role of sulfuric acid in the above reaction? Explain mechanistically. (12 pts.)
Given the expanded molecular formula give the IUPAC name for the organic compound: CH3CHCHCH2CH2CH(CH2CH3)CH2CH3 (It might help to take the expanded molecular formula and draw the structural formula) The IUPAC name of the molecule shown above is Give the family name for the organic compound shown here: C-C-C-C-NH2 The family name of the molecule shown above is a(n)
What is the name of this compound? CH3N-CH2CH3 CH3 o trimethylamine 2. Ф O diethylamine o ethyldimethylamine O ethylmethylamine butylamine