What is the systematic name (IUPAC name) of CH3CH2CH2CH(CH2CH3)CH2CH3?

Question

Question

science chemistry

Answer 1

Answer #1

3-ethylhexane

Answer 2

Similar Homework Help Questions

Write the common and systematic (IUPAC) names of the ether that has the following structure. H3C-O-CH2CH3...

Write the common and systematic (IUPAC) names of the ether that has the following structure. H3C-O-CH2CH3 Common name: Systematic name
write the common and systematic (IUPAC) names of the ether that has the following structure CH3---O---CH2CH3...

write the common and systematic (IUPAC) names of the ether that has the following structure CH3---O---CH2CH3 Common name: Systematic name:
? What are the systematic (IUPAC) names for the compounds shown? он. H3C systematic (IUPAC) name:...

? What are the systematic (IUPAC) names for the compounds shown? он. H3C systematic (IUPAC) name: B. H3C—CH2-CH-CH2 CH3 OH systematic (IUPAC) name:

What type of a compound is CH3CH2CH2CH(OH)CH2CH3?

What type of a compound is CH3CH2CH2CH(OH)CH2CH3?
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...

1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid
) What is the IUPAC name for the molecule below? Br CH2CH3 H3C

) What is the IUPAC name for the molecule below? Br CH2CH3 H3C

What is the systematic IUPAC name of the following compound?

What is the systematic IUPAC name of the following compound?
IUPAC systematic name?

IUPAC systematic name?
Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: CH-CH-CH-CCH

Give the systematic (IUPAC) name for each molecule. CH3CCH3 systematic (IUPAC) name: CH-CH-CH-CCH

Identify a systematic (IUPAC) name for each of thr following compounds 1. Identify a systematic (IUPAC) name for ea...

Identify a systematic (IUPAC) name for each of thr following compounds 1. Identify a systematic (IUPAC) name for each of the following Compounds A NO2