Question 2:
A) Calculate the pH of the buffer that results from mixing 56.1 mL of a 0.406 M solution of HCHO2 and 11.9 mL of a 0.606 M solution of NaCHO2. The Ka value for HCHO2 is 1.8×10−4
B) Calculate the initial pH and the final pH after adding 0.010 mol of NaOH.
300.0 mL of a buffer solution that is 0.225 M in HCHO2 and 0.280 M in KCHO2
C) Calculate the initial pH and the final pH after adding 0.010 mol of NaOH.
300.0 mL of a buffer solution that is 0.280 M in CH3CH2NH2 and 0.260 M in CH3CH2NH3Cl
D)
Which acid is the best choice to create a buffer with pH= 1.83?
Which acid is the best choice to create a buffer with 1.83?
| chlorous acid (HClO2),pKa=1.95 |
| hypochlorous acid (HClO),pKa=7.54 |
| nitrous acid (HNO2),pKa=3.34 |
| acetic acid (HCH3CO2),pKa=4.76 |
A)
pH of acidic buffer = pka + log(HcooNa/HCOOH)
pka of HCOOH = -logKa = -log(1.8*10^-4) = 3.74
no of mol of HCOOH = 56.1*0.406 = 22.78 mol
No of mol of HCOONa = 11.9*0.606 = 7.2 mmol
pH = 3.74+log(7.2/22.78)
= 3.24
B) initial pH
pH of acidic buffer = pka + log(HcooNa/HCOOH)
pka of HCOOH = -logKa = -log(1.8*10^-4) = 3.74
concentration of HCOOH = 0.225 M
Concentration of HCOONa = 0.28 M
pH = 3.74+log(0.28/0.225)
= 3.83
final pH
pH of acidic buffer = pka + log(HcooK+NaOH/HCOOH-NaOH)
pka of HCOOH = -logKa = -log(1.8*10^-4) = 3.74
concentration of HCOOH = 0.225 M
Concentration of HCOOk = 0.28 M
Concentration of NaOH added = n/v = 0.01/0.3 = 0.033 M
pH = 3.74+log((0.28+0.033)/(0.225-0.033))
pH = 3.95
C)
Basic buffer, initial pH
pOH = pkb+log(CH3CH3NH3Cl/CH3CH3NH2)
pkb of CH3CH3NH2 = -log(Kb) = -log(4.3*10^-4) = 3.36
concentration of CH3CH3NH2 = 0.28 M
Concentration ofCH3CH3NH3cl = 0.26 M
pOH = 3.36+log(0.26/0.28)
= 3.33
pH = 14-3.33 = 10.67
final pH
pOH = pkb+log(CH3CH3NH3Cl- NaOH/CH3CH3NH2+NaOH)
pkb of CH3CH3NH2 = -log(Kb) = -log(4.3*10^-4) = 3.36
concentration of CH3CH3NH2 = 0.28 M
Concentration ofCH3CH3NH3cl = 0.26 M
Concentration of NaOH added = n/v = 0.01/0.3 = 0.033 M
pOH = 3.36+log((0.26-0.033)/(0.28+0.033))
= 3.22
pH = 14-3.22 = 10.78
D) answer: chlorous acid (HClO2),pKa=1.95
Question 2: A) Calculate the pH of the buffer that results from mixing 56.1 mL of...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.0100 mol of NaOH. For 300.0 mL of a buffer solution that is 0.220 M in HCHO2 and 0.295 M in KCHO2, calculate the initial pH and the final pH after adding 0.0100 mol of NaOH(Ka=1.8⋅10−4). For 300.0 mL of a buffer solution that is 0.3187 M in CH3CH2NH2 and 0.2987 M in CH3CH2NH3Cl, calculate the initial pH and the final pH after adding...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.010 mol of NaOH. 12A. For 280.0 mL of a buffer solution that is 0.205 M in HCHO2 and 0.315 M in KCHO2, calculate the initial pH and the final pH after adding 0.010 mol of NaOH. 12B. For 280.0 mL of a buffer solution that is 0.325 M in CH3CH2NH2 and 0.295 M in CH3CH2NH3Cl, calculate the initial pH and the final pH...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.010 mol of NaOH. Part B 300.0 mL of a buffer solution that is 0.215 Min HCHO2 and 0.280 M in KCHO2 Express your answers using two decimal places separated by a comma. IVO ALO ? pH initial pH final Submit Request Answer Part C 300.0 mL of a buffer solution that is 0.300 M in CH3 CH2NH2 and 0.270 M in CH3 CH,...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.0150 mol of NaOH. A.For 210.0 mL of pure water, calculate the initial pH and the final pH after adding 0.0150 mol of NaOH. B. For 210.0 mL of a buffer solution that is 0.245 M in HCHO2 and 0.315 M in KCHO2, calculate the initial pH and the final pH after adding 0.0150 mol of NaOH(Ka=1.8⋅10−4). C. For 210.0 mL of a buffer...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.0150 mol of NaOH. 1). For 280.0 mL of pure water, calculate the initial pH and the final pH after adding 0.0150 mol of NaOH. 2). For 280.0 mL of a buffer solution that is 0.205 M in HCHO2 and 0.275 M in KCHO2, calculate the initial pH and the final pH after adding 0.0150 mol of NaOH(Ka=1.8⋅10^−4). 3).For 280.0 mL of a buffer...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.005 mol of NaOH. a. For 220.0 mL of pure water, calculate the initial pH and the final pH after adding 0.005 mol of NaOH. Express your answers using two decimal places separated by a comma. (I already did part a) pHinitial, pHfinal = 7.00,12.36 b. For 220.0 mL of a buffer solution that is 0.225 M in HCHO2 and 0.280 M in KCHO2,...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.005 mol of NaOH. 1) For 260.0 mL of a buffer solution that is 0.230 M in HCHO2 and 0.310 M in KCHO2, calculate the initial pH and the final pH after adding 0.005 mol of NaOH. Express your answers using two decimal places separated by a comma. 2) For 260.0 mL of a buffer solution that is 0.290 M in CH3CH2NH2 and 0.265...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.0100 mol of NaOH (For all answers express answers using two decimal places seperated by a comma) A) For 250.0 mL of pure water, calculate the initial pH and the final pH after adding 0.0100 mol of NaOH B) For a 250.0 mL of a buffer solution that is 0.235 M in HCHO2 and 0.275 M in KCHO2, calculate the initial pH and the...
For each of the following solutions, calculate the initial pH and the final pH after adding 0.0200 mol of NaOH . Part A For 270.0 mL of pure water, calculate the initial pH and the final pH after adding 0.0200 mol of NaOH . Express your answers using two decimal places separated by a comma. SubmitHintsMy AnswersGive UpReview Part Part B For 270.0 mL of a buffer solution that is 0.230 M in HCHO2 and 0.280 M in KCHO2 ,...
For 300.0 mL of a buffer solution that is 0.325 M in CH3CH2NH2 and 0.300 M in CH3CH2NH3Cl, calculate the initial pH and the final pH after adding 0.005 mol of NaOH.