10Ml Pb(NO3)2 is added to to 20ml Kl forming 46.1g precipitate. Write a balanced equation and...

Question

Question

10Ml Pb(NO3)2 is added to to 20ml Kl forming 46.1g precipitate. Write a balanced equation and find M for Pb(NO3)2 and KI.

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

Consider the balanced equation of KI reacting with Pb(NO3)2 to form a precipitate. 2KI(aq)+Pb(NO3)2(aq)⟶PbI2(s)+2KNO3(aq) What mass...

Consider the balanced equation of KI reacting with Pb(NO3)2 to form a precipitate. 2KI(aq)+Pb(NO3)2(aq)⟶PbI2(s)+2KNO3(aq) What mass of PbI2 can be formed by adding 0.413 L of a 0.140 M solution of KI to a solution of excess Pb(NO3)2?
Write the balanced chemical equation for each of the reactions. Include phases. When aqueous sodium hydroxide...

Write the balanced chemical equation for each of the reactions. Include phases. When aqueous sodium hydroxide is added to a solution containing lead(II) nitrate, a solid precipitate forms. equation: 2 NaOH + Pb(NO3)2 + Pb(OH), + 2NaNO, However, when additional aqueous hydroxide is added, the precipitate redissolves, forming a soluble (Pb(OH),12- (aq) complex ion. equation: Pb(OH), +20H (Pb(OH) 2 -
Formula of precipitate Pb(NO3)2(aq) + Kl(aq) → NaOH(aq) + KNO3(aq) → NaOH(aq) + Fe(NO3)2(aq) →

Formula of precipitate Pb(NO3)2(aq) + Kl(aq) → NaOH(aq) + KNO3(aq) → NaOH(aq) + Fe(NO3)2(aq) →

I need help plotting the mass of precipitate versus moles of Pb(NO3)2 . Reaction Equation: Pb(NO3)2...

I need help plotting the mass of precipitate versus moles of Pb(NO3)2 . Reaction Equation: Pb(NO3)2 + 2KBr → PbBr2 + 2KNO3 Volume (mL) Solution Mixture 0.50 M Pb(NO3)2 0.50 M KBT 2.00 18.00 4.00 16.00 6.00 14.00 8.00 12.00 10.00 10.00 12.00 8.00 14.00 6.00 16.00 4.00 18.00 2.00 Data Collection | Experimental Data Assignment Number Volume Pb(NO3)2 16m Moles Pb(NO3)2 Volume KBr 114 mL Moles KBT Mass of watchglass and filer paper (g) 28.7455 | 1st heating: Mass...
Consider the following reaction Pb(NO3 )2 (aq) + AlCl3 (aq) à (Write a balanced equation) :...

Consider the following reaction Pb(NO3 )2 (aq) + AlCl3 (aq) à (Write a balanced equation) : How many litters of 2.00 M of Pb(NO3)2 will react with 6.00 kg of AlCl3 (MM = 133.33 g / mol)? A: 35.6 L B: 33.8L C: 22.8 L D: 67.5 L
Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:

Na2SO4+Pb(NO3)2=Na2(NO3)2+PbSO4 Balanced equation: Ionic equation:

A precipitate will form when aqueous Pb(NO3)2 is added to an aqueous solution of: A)Cu(NO3)2 B)NaI C)NaCH3CO2 D)Pb(CIO4)...

A precipitate will form when aqueous Pb(NO3)2 is added to an aqueous solution of: A)Cu(NO3)2 B)NaI C)NaCH3CO2 D)Pb(CIO4)2 E)KNO3
10.2 g of Pb(NO3)2 are dissolved in 100 mL of water, and added to 250.0 mL...

10.2 g of Pb(NO3)2 are dissolved in 100 mL of water, and added to 250.0 mL of a 0.250 M solution of KI. Determine the mass in grams of PbI2 produced, and find the number of moles of the excess reagent. I could only find the net ionic equation of: Pb 2+ (aq) + 2 I- (aq) -> PbI2 (s)
A precipitate will form when aqueous Pb(NO3)2 is added to an aqueous solution of ____. A....

A precipitate will form when aqueous Pb(NO3)2 is added to an aqueous solution of ____. A. NaCH3CO2 B. CaBr2 C. Ca(ClO4)2 D. NaNO3 Please answer quickly!

Write the balanced chemical equation for each of the reactions. Include phases. When aqueous sodium hydroxide...

Write the balanced chemical equation for each of the reactions. Include phases. When aqueous sodium hydroxide is added to a solution containing lead(II) nitrate, a solid precipitate forms. equation: However, when additional aqueous hydroxide is added, the precipitate redissolves, forming a soluble [Pb(OH)4]2−(aq)[Pb(OH)4]2−(aq) complex ion. equation: