HomeworkLib
Question

H2PO (aq) + OH (aq) + Pd (s) -> HPO4 (aq) + H2O (l) The rate...

H2PO (aq) + OH (aq) + Pd (s) -> HPO4 (aq) + H2O (l)

The rate law for this reaction was determined experimentally to be:

Rate=k[H2PO4]3[OH]

A. What do you think the purpose of the Pd (s) is?

B. Define the reaction order with respect to each reactant.

C. What is the overall reaction order?

D. Consider the hydroxide ion, how could you prove (graphically) that the reaction order denoted above is true?

science   chemistry   
0 0
Add a comment Improve this question Transcribed image text
Next > < Previous
Sort answers by oldest

Homework Answers

Answer #1

a) The purpose of the metal Pd is to act as a catalyst in order to reduce the energy barrier for the reaction by providing the surface for the reaction

b) Reaction order with respect to H2PO4- will be 3

Reaction order with respect to OH- will be equal to 1

c) Overall Reaction order will be (3+1) = 4

d) For [OH-] since it is order 1 with respect to reaction, we can plot the graph of ln[OH-], which is the ln of the concentration of OH- with respect to time to make sure it is a straight line in order to satisfy the first order in the overall reaction order.

Note - Post any doubts/querie in comments section.

0 0
Add a comment
Know the answer?
Add Answer to:
H2PO (aq) + OH (aq) + Pd (s) -> HPO4 (aq) + H2O (l) The rate...
Your Answer:

Post as a guest

Your Name:

What's your source?

Earn Coins

Coins can be redeemed for fabulous gifts.

Log In

Sign Up

Not the answer you're looking for? Ask your own homework help question. Our experts will answer your question WITHIN MINUTES for Free.
Similar Homework Help Questions

  • For the reaction 2ClO2(aq) + 2OH-(aq) --> ClO3-(aq) + H2O(l) the rate law is written Rate...

    For the reaction 2ClO2(aq) + 2OH-(aq) --> ClO3-(aq) + H2O(l) the rate law is written Rate = k [ClO2]2 [OH-] a. What is the reaction order with respect to ClO2? _____________ b. Is the reaction order with respect to OH- second order? Why or why not? c. What is the overall reaction order? ____________________ d. If the concentration of ClO2 is doubled, the rate of the reaction would increase by a factor of ____________. Show how was the answer determined?

  • Consider the following reaction: 2 ClO2(aq) + 2 OH-(aq) ClO3-(aq) + ClO3-(aq) + H2O(l) (a) The...

    Consider the following reaction: 2 ClO2(aq) + 2 OH-(aq) ClO3-(aq) + ClO3-(aq) + H2O(l) (a) The rate law for this reaction is second order in ClO2(aq) and first order in OH-(aq). What is the rate law for this reaction? Rate = k [ClO2(aq)] [OH-(aq)] Rate = k [ClO2(aq)]2 [OH-(aq)]     Rate = k [ClO2(aq)] [OH-(aq)]2 Rate = k [ClO2(aq)]2 [OH-(aq)]2 Rate = k [ClO2(aq)] [OH-(aq)]3 Rate = k [ClO2(aq)]4 [OH-(aq)] (b) If the rate constant for this reaction at a certain...

  • Consider the following reaction: Ba(OH)2 (aq) + H2SO4 (aq) ⟶ BaSO4 (s) + 2 H2O (l)...

    Consider the following reaction: Ba(OH)2 (aq) + H2SO4 (aq) ⟶ BaSO4 (s) + 2 H2O (l) If you add an excess of sulfuric acid to 85.67 g of barium hydroxide, how many grams of water will you expect to produce?

  • 5. Given the reaction OCT (aq) + I (aq) → OT (aq) + Cl(aq) tienis Rate...

    5. Given the reaction OCT (aq) + I (aq) → OT (aq) + Cl(aq) tienis Rate = k1110017. Th The rate law for this reaction is Rate =k! . The overall reaction order and the [OH"] order with respect to OH are A) 2 and -1. B) O and -1. C) 0 and 1. D) 2 and 1. E) 1 and -1. 6. The following data were obtained for the hypothetical reaction 2A + B → products, [A] (M) [B]...

  • Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e-...

    Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e- ----> Ni(OH)2(s)+H2O(l)+OH-(aq) Express the reduction as a chemical equation including phases and electrons.

  • Be sure to answer all parts. Consider the following mechanism: (1) ClO−(aq) + H2O(l) ⇌ HClO(aq)...

    Be sure to answer all parts. Consider the following mechanism: (1) ClO−(aq) + H2O(l) ⇌ HClO(aq) + OH−(aq)  [fast] (2) I−(aq) + HClO(aq) → HIO(aq) + Cl−(aq)  [slow] (3) OH−(aq) + HIO(aq) → H2O(l) + IO−(aq)  [fast] (a) What is the overall equation? Select the single best answer.    ClO−(aq) + I−(aq) ⇌ IO−(aq) + H2O(l) + Cl−(aq)    ClO−(aq) + I−(aq) → IO−(aq) + H2O(l) + Cl−(aq)    ClO−(aq) + I−(aq) → IO−(aq) + Cl−(aq)    ClO−(aq) + I−(aq) ⇌ IO−(aq) +...

  • 1. For the reaction 3 CIO - (aq) → CIO, - (aq) + 2Cl(aq) doubling the...

    1. For the reaction 3 CIO - (aq) → CIO, - (aq) + 2Cl(aq) doubling the concentration of CIOquadruples the initial rate of formation of CIO:: What is the rate expression for the reaction? is first order in CsH5N_CI 2. The reaction CoHsN2Cl(aq) + H2O(l) → CH5OH(aq) + N2 (g) + HCl(aq) and zero order in H2O. What is the rate expression? 3. For the reaction 2 NO(g) + Cl2(g) → 2 NOCI (g) If the concentration of NO is...

  • Aluminum hydroxide reacts with sulfuric acid as follows: 2Al(OH)3(s)+3H2SO4(aq)→Al2(SO4)3(aq)+6H2O(l) Which reagent is the limiting reactant when...

    Aluminum hydroxide reacts with sulfuric acid as follows: 2Al(OH)3(s)+3H2SO4(aq)→Al2(SO4)3(aq)+6H2O(l) Which reagent is the limiting reactant when 0.550 mol  Al(OH)3 and 0.550 mol  H2SO4 are allowed to react? Al2(SO4)3(aq) Al(OH)3(s) H2O(l) H2SO4(aq)

  • GIVEN THE FOLLOWING DATA FOR THIS REACTION: NH4+(aq) + NO2-(aq) ---> N2(g) + 2H2O(l) EXPT NH4+...

    GIVEN THE FOLLOWING DATA FOR THIS REACTION: NH4+(aq) + NO2-(aq) ---> N2(g) + 2H2O(l) EXPT NH4+ NO2- RATE 1 0.010 M 0.020 M 0.020 M/s 2 0.015 M 0.020 M 0.030 M/s 3 0.010 M 0.010 M 0.005 M/s a. Calculate the order of reaction with respect to NH4+ b. Calculate the order of reaction with respect to NO2- c. Calculate the rate constant k d. Determine the overall order of reaction e. Determine the rate law

  • Review | Constants Periodic Table Leaming Goal: To understand reaction order and rate constants. For the...

    Review | Constants Periodic Table Leaming Goal: To understand reaction order and rate constants. For the general equation A+B+C+ dD. the rate law is expressed as follows: ratek AB" where mand n indicate the order of the reaction with respect to each reactant and must be determined experimentally and kis the rate constant, which is specific to each reaction Order For a particular reaction, aA +bB+CD the rate law was experimentally determined to be rate - KABC -- EBC2 A....

ADVERTISEMENT
Free Homework Help App
Download From Google Play
Scan Your Homework
to Get Instant Free Answers
Need Online Homework Help?
Ask a Question
Get Answers For Free
Most questions answered within 3 hours.
ADVERTISEMENT
ADVERTISEMENT