Calculate G° for each reaction at 298K using G°f values. 2 CH3OH(g) + 3 O2(g) 2...

Question

Question

Calculate G° for each reaction at 298K using G°f values.

2 CH3OH(g) + 3 O2(g) 2 CO2(g) + 4 H2O(g) kJ

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

Calculate the enthalpy change for the reaction C (graphite) + 2 H2 (g) + ½ O2...

Calculate the enthalpy change for the reaction C (graphite) + 2 H2 (g) + ½ O2 (g) → CH3OH (ℓ) Using the following information: C (graphite) + O2 (g) → CO2 (g) ΔHf° = –393.5 kJ H2 (g) + ½ O2 (g) → H2O (ℓ) ΔHf° = –285.8 kJ CH3OH (ℓ) + 3/2 O2 (g) → CO2 (g) + 2 H2O (ℓ) ΔHrxn° = –726.4 kJ a. –238.7 kJ b. 1691.5 kJ c. –1691.5 kJ d. 47.1 kJ e. –47.1...
Consider the reaction: H2CO(g) + O2(g)CO2(g) + H2O(l) Using standard thermodynamic data at 298K, calculate the...

Consider the reaction: H2CO(g) + O2(g)CO2(g) + H2O(l) Using standard thermodynamic data at 298K, calculate the free energy change when 1.87 moles of H2CO(g) react at standard conditions. G°rxn = kJ
AH = -727 kJ Given that CH3OH (1) + 3/2 O2 (g) → CO2 (g) +...

AH = -727 kJ Given that CH3OH (1) + 3/2 O2 (g) → CO2 (g) + 2 H2O(1) CO(g) + 1/2O2 (g) → CO2 (9) CH3OH(1) → CH3OH(g) AH = -284 kJ AH = 38 kJ H20 (1)→ H20 (9) AH = 44 kJ what is AH, in kJ, for the reaction CH3OH (g) + O2(g) →CO (g) + 2 H2O (9)

For the following chemical reaction DH = -1453 kJ: 2 CH3OH(l) + 3 O2(g) ---> 2...

For the following chemical reaction DH = -1453 kJ: 2 CH3OH(l) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) How much energy in kilojoules will be released when 250 g of CH3OH undergo combustion? (M.M. (CH3OH) = 32.04) a)11337 kJ b)5669 kJ c)2834 kJ d)726.5 kJ e)1453 kJ
For the following chemical reaction DH = -1453 kJ: 2 CH3OH(l) + 3 O2(g) ---> 2...

For the following chemical reaction DH = -1453 kJ: 2 CH3OH(l) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) How much energy in kilojoules will be released when 100 g of CH3OH undergo combustion? (M.M. (CH3OH) = 32.04) a)726.5 kJ b)2906 kJ c)4535 kJ d)1453 kJ e)2267 kJ
13 Calculate AHo, 298K for the following reaction: CO(g)1/2 O2(g) CO2(g) Given: AHof,298K (in kJ mol-1):...

13 Calculate AHo, 298K for the following reaction: CO(g)1/2 O2(g) CO2(g) Given: AHof,298K (in kJ mol-1): CO(g): -110.53 CO2(g): -393.51

1. Consider the reaction: H2CO(g) + O2(g)CO2(g) + H2O(l) Using standard absolute entropies at 298K, calculate...

1. Consider the reaction: H2CO(g) + O2(g)CO2(g) + H2O(l) Using standard absolute entropies at 298K, calculate the entropy change for the system when 2.41 moles of H2CO(g) react at standard conditions. S°system =___ J/K 2. For the reaction 3Fe2O3(s) + H2(g)>2Fe3O4(s) + H2O(g) DeltaH° = -6.0 kJ and DeltaS° = 88.7 J/K The standard free energy change for the reaction of 1.78 moles of Fe2O3(s) at 292 K, 1 atm would be ___ kJ. This reaction is (reactant, or product) favored...
Which of the following the correct expression of Q for the following reaction 2 CH3OH(g) +...

Which of the following the correct expression of Q for the following reaction 2 CH3OH(g) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) a. [CH3OH]2[O2]3/[CO2]2[H2O]4 b. [CH3OH]2[O2]3/[CO2]2 c. [CO2]2/[CH3OH]2[O2]3 d. [CO2]2[H2O]4/[CH3OH]2[O2]3 e. (2[CH3OH])(3[O2])/(2[CO2])(4[H2O])
10. Given the themochemical equation for the combustion of methanol. 2 CH3OH(g) + 3 O2(g) ®...

10. Given the themochemical equation for the combustion of methanol. 2 CH3OH(g) + 3 O2(g) ® 2 CO2(g) + 4 H2O(l) DrH = −1453 kJ/mol reaction d. Review the units “kJ/mol reaction”. What does “mole reaction” mean? e. If you produce 857 kJ of heat, how many “mole reactions” occurred? f. Relate the energy of the “mole reaction” to moles of methanol and determine the mass (in grams) of methanol needed.

Use Hess’s law to calculate ∆H° forthe reaction:C(s) + 2H2(g) +½O2(g) → CH3OH(l)...

Use Hess’s law to calculate ∆H° for the reaction:C(s) + 2H2(g) + ½O2(g) → CH3OH(l) ∆H°∘= ?using only the following data:H2(g) + ½O2(g) → H2O(l) ∆H°= -285.8 kJC(s) + O2(g) → CO2(g) ∆H°= -393.5 kJ2CH3OH(g) + 3O2(g) → 2CO2(g) + 4H2O(l) ∆H°= -1452.8 kJ