Which of the following the correct expression of Q for the following reaction
2 CH3OH(g) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l)
a. [CH3OH]2[O2]3/[CO2]2[H2O]4
b. [CH3OH]2[O2]3/[CO2]2
c. [CO2]2/[CH3OH]2[O2]3
d. [CO2]2[H2O]4/[CH3OH]2[O2]3
e. (2[CH3OH])(3[O2])/(2[CO2])(4[H2O])

Which of the following the correct expression of Q for the following reaction 2 CH3OH(g) +...
For the following chemical reaction DH = -1453 kJ: 2 CH3OH(l) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) How much energy in kilojoules will be released when 250 g of CH3OH undergo combustion? (M.M. (CH3OH) = 32.04) a)11337 kJ b)5669 kJ c)2834 kJ d)726.5 kJ e)1453 kJ
For the following chemical reaction DH = -1453 kJ: 2 CH3OH(l) + 3 O2(g) ---> 2 CO2(g) + 4 H2O(l) How much energy in kilojoules will be released when 100 g of CH3OH undergo combustion? (M.M. (CH3OH) = 32.04) a)726.5 kJ b)2906 kJ c)4535 kJ d)1453 kJ e)2267 kJ
Methanol, CH3OH (l), combusts according to the following equation: 2 CH3OH (l) + 3 O2 (g) → 2 CO2 (g) + 4 H2O (l) ∆rHo (298 K) = −1452 kJ Here is a list of Entropies of formation: S (J K-1 mol-1) at 298 K CH3OH (l) =126.8 O2 (g) = 205.14 CO2 (g) = 213.74 H2O = (l) 69.91 (a) If the above reaction was used in a fuel cell, say, to perform work, what will be the maximum...
1) What is the correct mathematical expression for the reaction quotient, Qc, for the following reaction: CH(E) + 2O2(g) = CO2(g) + 2H20 (1) [CH][02] [CO2][H2012 [CH][02] [CO2] L = LIQUID (CO2) [CH][0212 (d) 1C02) P2012 [CH][02] e) None of the above. 2) A change of pressure has no effect on which of the following reactions at equilibrium? 1) 2502(g) + O2(g) = 2503(8) 2) 4NH3(g) +502(g) = 4NO(g) + 6H2O(g) 3) CH2(g) + Cl2(g) = CH2Cl(g) + HCl(g) 4)...
What is the correct equilibrium constant expression for the following reaction? C4H10(g) + 132132 O2(g) ↽−−⇀↽−−⇀ 4 CO2(g) + 5 H2O(g)
Which is the correct equilibrium constant expression for the following reaction? 2 NaHCO3(s) Na2CO3(s) + CO2(g) + H2O(g) O A. Kc=[Na2CO3] / [NaHCO3)2 O B. Kc = [NaHCO3] 2 / [Na2CO3][ CO2][ H20] O C. Kc = [ CO2][ H20] OD. Kc = [Na2CO3][ CO2][ H20] / [NaHCO3)2
Calculate G° for each reaction at 298K using G°f values. 2 CH3OH(g) + 3 O2(g) 2 CO2(g) + 4 H2O(g) kJ
Calculate the enthalpy change for the reaction C (graphite) + 2 H2 (g) + ½ O2 (g) → CH3OH (ℓ) Using the following information: C (graphite) + O2 (g) → CO2 (g) ΔHf° = –393.5 kJ H2 (g) + ½ O2 (g) → H2O (ℓ) ΔHf° = –285.8 kJ CH3OH (ℓ) + 3/2 O2 (g) → CO2 (g) + 2 H2O (ℓ) ΔHrxn° = –726.4 kJ a. –238.7 kJ b. 1691.5 kJ c. –1691.5 kJ d. 47.1 kJ e. –47.1...
Write the expression for the reaction quotient, Qc, for each of the following reactions: 4 NH3(g) + 5 O2(g) ⇌ 4 NO(g) + 6 H2O(g) CH4(g) + 2 O2(g) ⇌ CO2(g) + 2 H2O(l)
The equilibrium constant expression K c for the reaction CH4 (g) + 2O2 (g) <--> CO2 (g) + 2H2O (g) is __________. A. Kc = [CO2][H2O]/[CH4][O2] B. Kc = [CO2][H2O]2/[CH4][O2]2 C. Kc = [CH4][O2]/[CO2][H2O] D. Kc = [CH4][O2]2/[CO2][H2O]2