Balance these redox reactions Br- + SO4^-2 -> Br2 + SO2 Cu + NO3^- -> Cu^+2...

Question

Question

Balance these redox reactions

Br- + SO4^-2 -> Br2 + SO2

Cu + NO3^- -> Cu^+2 + NO2

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)

Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)
Determine the products of the following reactions. After, balance them: a) Fe2(SO4)3 + H2O + SO2...

Determine the products of the following reactions. After, balance them: a) Fe2(SO4)3 + H2O + SO2 + KMnO4 = b) Fe2(SO4)3 + H2O + SO2 + KCr2O7 = c) Fe2(SO4)3 + H2O + SO2 + H2O2 = d) What would the above 3 reactions look like if you added KSCN? Write the balanced equations for them. *these were all apart of a chem lab in order to detect the presence of Fe+2 ions* *these are redox reactions*
Which of the following are redox reactions? 2AgNO3(aq) + Cu(s) + Cu(NO3)2(aq) + 2Ag(s) 2Cus(s) +...

Which of the following are redox reactions? 2AgNO3(aq) + Cu(s) + Cu(NO3)2(aq) + 2Ag(s) 2Cus(s) + O2(g) + Cu(s) + SO2(g) 2AgNO3(aq) + Na2SO4(aq) + 2NaNO3(aq) + Ag2SO4(s) CO(g) + H2O(g) + CO2(g) + H2(g) CO2(g) + 2H20(1) + H30+(aq) + HCO3(aq)

Balance Redox Equations (Basic Solution) with steps. 1. Mn^2+ (aq) + Br2(l) = MnO2 (s) + Br^- (aq) 2. NO2^- (aq) + MnO4^...

Balance Redox Equations (Basic Solution) with steps. 1. Mn^2+ (aq) + Br2(l) = MnO2 (s) + Br^- (aq) 2. NO2^- (aq) + MnO4^- (aq) = NO3^- (aq) + MnO2 (s) 3. N2H4 (g) + ClO3^- (aq) = NO(g) + Cl^- (aq)
In a particular redox reaction, NO2- is oxidized to NO3- and Cu2+ is reduced to Cu+. Complete...

In a particular redox reaction, NO2- is oxidized to NO3- and Cu2+ is reduced to Cu+. Complete and balance the equation for this reaction in acidic solution. Phases are optional. What is the balanced redox reaction? Can you elaborate why the answer is not " NO2- + Cu2+ + H2O ---> NO3- + Cu+ + 2H+ "
In a particular redox reaction, NO2– is oxidized to NO3– and Cu2 is reduced to Cu...

In a particular redox reaction, NO2– is oxidized to NO3– and Cu2 is reduced to Cu . Complete and balance the equation for this reaction in acidic solution.

UPJ LUIS 2. Determine which of the following reactions are “redox" reactions. Circle the "letter' of...

UPJ LUIS 2. Determine which of the following reactions are “redox" reactions. Circle the "letter' of only those that represent redox reactions. a. Cu + 4HNO3 = 2 NO2 + 2 H2O + 2 Cu(NO3)2 b. Zn + 2 H+ = Zn2+ + H2 C. BaCl2 + H2SO4 = 2 HCI + BaSO4 d. H+ + Br- => HBr e. 2 Fe + 3 Cl = 2 FeCl3 f. AgNO3 + HCI = AgCl + HNO3 g. 2NaOH + H2SO4...
In a particular redox reaction, NO2- is oxidized to NO3- and Cu2+ is reduced to Cu+.

In a particular redox reaction, NO2- is oxidized to NO3- and Cu2+ is reduced to Cu+. Complete and balance the equation for this reaction in acidic solution. Phases are optional.
1. Balance the three copper reactions: + H20 (1) Cu(NO3)2 (aq) + NO2(g) i) Cu (s)...

1. Balance the three copper reactions: + H20 (1) Cu(NO3)2 (aq) + NO2(g) i) Cu (s) + HNO3 (aq) ii) Cu(NO3)2 (aq) + NaOH(aq) Cu(OH)2 (s) + NaNO3(aq) (aq) - iii) Cu(OH)2 (S) Cuo(s) + H2O (1) 2. In reaction (i), suppose you add 4.0 mL of 6 M nitric acid to a sphere of copper metal that weighs 0.65 grams. Which reactant is the limiting reagent? (Show your work)

Balance the redox reaction given 7. H → NO2+ Fe + SO4 + H2O FeS2 +...

Balance the redox reaction given 7. H → NO2+ Fe + SO4 + H2O FeS2 + NO3 + (pyrite) Oxidation Half Reaction: Reduction Half Reaction: Oxidizing agent: Reducing agent