Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)
The reaction is:
Cu + H2SO4 —> H2O + SO2 + CuSO4
Balance S:
Cu + 2 H2SO4 —> H2O + SO2 + CuSO4
Balance H:
Cu + 2 H2SO4 —> 2 H2O + SO2 + CuSO4
The equation is now balanced
Answer:
Cu + 2 H2SO4 —> 2 H2O + SO2 + CuSO4
Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)
Balance these redox reactions Br- + SO4^-2 -> Br2 + SO2 Cu + NO3^- -> Cu^+2 + NO2
Determine the products of the following reactions. After, balance them: a) Fe2(SO4)3 + H2O + SO2 + KMnO4 = b) Fe2(SO4)3 + H2O + SO2 + KCr2O7 = c) Fe2(SO4)3 + H2O + SO2 + H2O2 = d) What would the above 3 reactions look like if you added KSCN? Write the balanced equations for them. *these were all apart of a chem lab in order to detect the presence of Fe+2 ions* *these are redox reactions*
Balance the following equation: Al(s) + KOH(aq) + H2SO4(aq) + H2O(l) ---> KAl(SO4)2 * 12 H2O(s) + H2(g)
Given: Cu(SO4).5(H2O) + 4 NH3 ----> Cu(NH3)4(SO4). H2O + 4 H2O The chemical formula for its complex ion is: The charge on its complex ion is: The chemical formula for its ligand is: Is the ligand an ion or a molecule? The charge on the ligand is: The chemical symbol for its transition metal is: The oxidation state on its transition metal is: Counter ions in a coordination compound serve to balance the charge on the complex ion. The chemical...
Cu + HNO3 ---> Cu(NO3)2 + H2O + NO Balance the Equation
What is the IUPAC name for [Cu(NH3)4(SO4)]*H2O
1.. How would you formally name the compound [Cu(NH3)4]SO4*H2O prepared in this laboratory? A. tetraaminesulfatecopper monohydrate B. aminecopper(I) sulfate monohydrate C. tetraaminecopper(II) sulfate monohydrate D. tetraaminecopper(I) sulfate monohydrate
30. In the following equation which one of the compounds is acting as an acid H2(SO4) + H2O --> HSO4- + H3O+ a. H2O (Incorrect) b. H2SO4 c. H3O+ d. HSO4- e. none of the above
What is the percent by mass of NH3 (% of NH3 ) in the compound [Cu(NH3)4]SO4.H2O ?
For a particular redox reaction, SO2−3− is oxidized to SO2−4and Cu2+ is reduced to Cu+. Complete and balance the equation for this reaction in basic solution. The phases are optional. balanced reaction: SO2−3+Cu2+⟶SO2−4+Cu+