What is the IUPAC name for [Cu(NH3)4(SO4)]*H2O

Question

Question

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

What is the percent by mass of NH3 (% of NH3 ) in the compound [Cu(NH3)4]SO4.H2O...

What is the percent by mass of NH3 (% of NH3 ) in the compound [Cu(NH3)4]SO4.H2O ?
Given: Cu(SO4).5(H2O) + 4 NH3 ----> Cu(NH3)4(SO4). H2O + 4 H2O The chemical formula for its...

Given: Cu(SO4).5(H2O) + 4 NH3 ----> Cu(NH3)4(SO4). H2O + 4 H2O The chemical formula for its complex ion is: The charge on its complex ion is: The chemical formula for its ligand is: Is the ligand an ion or a molecule? The charge on the ligand is: The chemical symbol for its transition metal is: The oxidation state on its transition metal is: Counter ions in a coordination compound serve to balance the charge on the complex ion. The chemical...
1.. How would you formally name the compound [Cu(NH3)4]SO4*H2O prepared in this laboratory? A. tetraaminesulfatecopper monohydrate...

1.. How would you formally name the compound [Cu(NH3)4]SO4*H2O prepared in this laboratory? A. tetraaminesulfatecopper monohydrate B. aminecopper(I) sulfate monohydrate C. tetraaminecopper(II) sulfate monohydrate D. tetraaminecopper(I) sulfate monohydrate

Correctly name the following complexes: a). [Co(NH3)6]Br3 b). K3[FeF6] c). [Cu(OH2)4](SO4)

Correctly name the following complexes: a). [Co(NH3)6]Br3 b). K3[FeF6] c). [Cu(OH2)4](SO4)
5. Name the following compounds: a) [CuCl4)? b) [Cr(H2O)(NH3)]*2 c) [Cr(H2O) (NH3)]SO4 d) K3 [Fe(CN)6]

5. Name the following compounds: a) [CuCl4)? b) [Cr(H2O)(NH3)]*2 c) [Cr(H2O) (NH3)]SO4 d) K3 [Fe(CN)6]
Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)

Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)

Name the following compounds: 5. a) CuCla]2 b) Cr(H20)(NH3)]2 c) [Cr(H2O)4(NH)] SO4 d) K3[Fe(CN)6]

Name the following compounds: 5. a) CuCla]2 b) Cr(H20)(NH3)]2 c) [Cr(H2O)4(NH)] SO4 d) K3[Fe(CN)6]
Give the major product and the IUPAC name. Na 3. NH3() IUPAC Name +Nat H-NH 4...

Give the major product and the IUPAC name. Na 3. NH3() IUPAC Name +Nat H-NH 4 trans-1-m 4propune-2 butene +Ni - H Na -N-A + H-NH +Nat y
2. Calculate the volume of 15.0M ammonia (NH3) needed to prepare 1.50 grams of tetramminecopper (II)...

2. Calculate the volume of 15.0M ammonia (NH3) needed to prepare 1.50 grams of tetramminecopper (II) sulfate monohydrate [Cu(NH3)4]sO4 H2O according to the overall reaction on the first page of the lab. calaboorhance at 740 nm calculate the enerav of one photon overall net equation for the reaction is: Cu(H2O)4] SO4 H2O (aq) + 4 NH3 (aq)-[Cu(NH3)4]SO4 H2O + +4 H2O ()

Nastly Concentrates B Hoe 4 H₂SO4 Draw struture & give UPAC give IUPAC name for each...

Nastly Concentrates B Hoe 4 H₂SO4 Draw struture & give UPAC give IUPAC name for each product