Consider a 0.400 M CH3COOH solution (Ka=1.8*10^-5) and determine the [H3O+] concentration at equilibrium

Question

Question

science chemistry

Answer 1

Answer #1

We know

Ka = [CH3COO-][H3O+]/[CH3COOH]

Let X= [CH3COO-][H3O+]

1.8×10^-5= X * X/ (0.4-X)

X² = 1.8×10^-5 (0.4-x)

On solving this quadratic equation we know that get

X=[H3O+] = 0.0002674 = 2.674×10^-4

Answer 2

Similar Homework Help Questions

using the equilibrium expression and the Ka of 1.8 X 10-5, Determine the Morality of the CH3COOH solution. With a Ph of 4,6.

using the equilibrium expression and the Ka of 1.8 X 10-5, Determine the Morality of the CH3COOH solution. With a Ph of 4,6.
The following equilibrium is established in water solution: CH3COOH + H20 = CH3C00+H307 Ka=1.8 x 10-5...

The following equilibrium is established in water solution: CH3COOH + H20 = CH3C00+H307 Ka=1.8 x 10-5 Which of the following is false? a CH3COO is the conjugate acid of CH3COOH. b. Hydroxide concentration is negligible with respect to hydrogen ion concentration. OO H2O is a weak base. Od. H2O is the conjugate base of H307 De CH3COOH is a weak acid.
Determine the [H3O+] of a 0.220 M solution of formic acid (Ka=1.8×10−4).

Determine the [H3O+] of a 0.220 M solution of formic acid (Ka=1.8×10−4).

What is the pH of a 0.987 M CH3COOH aqueous solution at 25oC? Ka(CH3COOH)=1.8 x 10–5...

What is the pH of a 0.987 M CH3COOH aqueous solution at 25oC? Ka(CH3COOH)=1.8 x 10–5 1.92 2.38 11.62 6.98 5.22
Acetic acid (CH3COOH) dissociates in water with an equilibrium constant of 1.8 x 10^-5. Calculate the...

Acetic acid (CH3COOH) dissociates in water with an equilibrium constant of 1.8 x 10^-5. Calculate the equilibrium concentrations of all the compounds involved in that process if 2.0 M CH3COOH is initially mixed with 1.0M CH3COOH^- and 1.0 M H3O^+, then allowed to reach equilibrium. Also, determine the pH and pOH of the solution.
Determine [H3O+][H3O+] of a 0.200 MM solution of formic acid (Ka=1.8×10−4Ka=1.8×10−4).

Determine [H3O+][H3O+] of a 0.200 MM solution of formic acid (Ka=1.8×10−4Ka=1.8×10−4).

Determine the [H3O+][H3O+] of a 0.150 MM solution of formic acid (Ka=1.8×10−4Ka=1.8×10−4).

Determine the [H3O+][H3O+] of a 0.150 MM solution of formic acid (Ka=1.8×10−4Ka=1.8×10−4).
What is the pH of a 0.25 M solution of NaCH3COO (Ka (CH3COOH) = 1.8 * 10-5)?...

What is the pH of a 0.25 M solution of NaCH3COO (Ka (CH3COOH) = 1.8 * 10-5)? Instruction: Please have two decimal places for your answer
For the following dissociation of acetic acid, Ka = 1.760 x 10-5: CH3COOH + H2O ?...

For the following dissociation of acetic acid, Ka = 1.760 x 10-5: CH3COOH + H2O ? CH3COO- + H3O+ Sodium acetate completely dissociates in solution according to the following reaction: NaCH3COO ? Na+ + CH3COO- A solution was prepared which contains CH3COOH at a pre-equilibrium concentration of 0.05782 M and NaCH3COO at a pre-equilibrium concentration of 0.04991 M. I know all answers, just do not know how to find them. What is the equilibrium concentration of H3O+? (Answer: 0.00002037) What...

Calculate the pH of a .30 M solution of acetic acid (CH3COOH, Ka= 1.8 x 10^-5)...

Calculate the pH of a .30 M solution of acetic acid (CH3COOH, Ka= 1.8 x 10^-5) at 25 degrees Celsius.