balance equation Si4H10(I)+O2(g)-> SiO2(s)+H2O(I)

Question

Question

balance equation Si₄H_10(I)+O_2(g)-> SiO_2(s)+H₂O(I)

science chemistry

Answer 1

Answer #1

Si4 Hio + (3) si C)+H (u) si x4) s 4 H:2 X(5) HE 10 O3 C13) C13 0 2 bilane Find Si4 Hio s (e) 4s9 )+O (R) balance si Ho (2) 4

Answer 2

Similar Homework Help Questions

balance the equation Sio2(s) + C(s)-SiC(s) + CO(g)

balance the equation Sio2(s) + C(s)-SiC(s) + CO(g)
Balance the following equation. B2H6(g) + O2(g) -B203(s) + H2O(g) What is the stoichiometric coefficient for...

Balance the following equation. B2H6(g) + O2(g) -B203(s) + H2O(g) What is the stoichiometric coefficient for oxygen? 04 Previous Page Next Page Page 5
Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g)...

Hess's Law Practice Find AH° for the following equation: SiO2(s) + 4HF(g) → SiF4(g) + 2H2O(g) Using the following equations: Si(s) + O2(g) → SiO2(s) Si(s) + 2F2(g) → SiF4(g) H2(g) + F2(g) → 2HF(g) H2(g) + 4202(g) → H2O(g) AH = -910.9 kJ/mol rxn AH = -1651 kJ/mol rxn AH = -542 kJ/mol rxn AH = -241.8 kJ/mol rxn

Balance the following equation using whole numbers. What is the coefficient for SiO2? Si10 H22 +...

Balance the following equation using whole numbers. What is the coefficient for SiO2? Si10 H22 + O2 ⟶ SiO2+H2O
Calculate delta H rxn for each of the following: (a) SiO2(s) + 4HF(g) > SiF4(g) +...

Calculate delta H rxn for each of the following: (a) SiO2(s) + 4HF(g) > SiF4(g) + 2H2O(l) (b) C2H6(g) + O2(g) > CO2(g) + H2O(g) [unbalanced] 6.54 Calculate AHºrxn for each of the following: (a) SiO2(s) + 4HF(g) → SiF4(g) + 2H20(1) (b) CH6(g) + O2(g) → CO2(g) + H2O(g) [unbalanced]
Balance the following chemical equation (if necessary): C6H6(1) + O2(g) → H2O(g) + CO2(g)

Balance the following chemical equation (if necessary): C6H6(1) + O2(g) → H2O(g) + CO2(g)

Question 16 of 35 Submit Balance the following chemical equation (if necessary): SizHz(s) + O2(g) →...

Question 16 of 35 Submit Balance the following chemical equation (if necessary): SizHz(s) + O2(g) → SiO2(g) + H20 (9) Reset 3c, Reset 60 @ 1 2 3 4 5 6 7 8 9 0 (s) 2 0 Sights (SiO₂ (9) H₂O (aq) + H₂O) Tap here or pull up for additional resources
Balance the equation KBrO3(s)------->KBr(s)+O2(g)

Balance the equation KBrO3(s)------->KBr(s)+O2(g)
Fe(s)+O2(g)+H2O(l)=Fe(OH)3(s) A) Balance the equation. B) A 27.9-gram iron nail falls into a stream and remains...

Fe(s)+O2(g)+H2O(l)=Fe(OH)3(s) A) Balance the equation. B) A 27.9-gram iron nail falls into a stream and remains at the bottom rusting for many years. Eventually all the iron reacts to form rust. How many grams of rust form?

Balance the following chemical equation, then answer the following question. C8H18(g) + O2(g) →CO2(g)+H2O(g) How many...

Balance the following chemical equation, then answer the following question. C8H18(g) + O2(g) →CO2(g)+H2O(g) How many grams of oxygen are required to react with 14.0 grams of octane (C8H18) in the combustion of octane in gasoline? Express the mass in grams to one decimal place. ____ g O2