For H2SO4(aq) + 2NH4OH(aq) --> (NH4)2SO4(aq)+2H2O what is the: Total Ionic equation: Specator Ions: Net Ionic...

Question

Question

For H₂SO₄(aq) + 2NH₄OH(aq) --> (NH₄)₂SO₄(aq)+2H₂O what is the:

Total Ionic equation:

Specator Ions:

Net Ionic equation:

science chemistry

Answer 1

Answer #1

Balanced chemical Equation in H₂SO4 tag) + 2NH₂OH (99) (NHy jsou log) + 34,011) complete / Total ionic Equation & - 24+ (aq)

Answer 2

Similar Homework Help Questions

Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:

Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:
what is the total ionic (not net) equation of 2KAl(OH)4(aq)+H2SO4(aq)=2Al(OH)3(s)+K2SO4(aq)+2H2O(l)

what is the total ionic (not net) equation of 2KAl(OH)4(aq)+H2SO4(aq)=2Al(OH)3(s)+K2SO4(aq)+2H2O(l)
2. Write the net ionic equation for the following. Which ions are spectator ions? (NH4)2CO3(aq) +...

2. Write the net ionic equation for the following. Which ions are spectator ions? (NH4)2CO3(aq) + Cu(NO3)2(aq) → CuC03(s) + 2 NH4NOg(aq)

what is the total ionic equation of 2KAl(OH)4 (aq) + H2SO4(aq) —> 2Al(OH)3(s) +K2SO4(aq) +2H2O(l)

what is the total ionic equation of 2KAl(OH)4 (aq) + H2SO4(aq) —> 2Al(OH)3(s) +K2SO4(aq) +2H2O(l)
Write the complete ionic equation and the net ionic equation for each of the reactions: Co(NO3)2(aq)...

Write the complete ionic equation and the net ionic equation for each of the reactions: Co(NO3)2(aq) + K2CO3(aq) --> CoCO3(s) + 2KNO3(aq) AgNO3(aq) + CsI(aq) ---> AgI(s) + CsNO3(aq) KHCO3(aq) + KOH(aq) --> K2CO3(aq) + H2O(l) H2SO4(aq) + 2NH3(aq) --> (NH4)2SO4(aq) 3Mg(s) + 2FeCl3(aq) --> 3MgCl2(aq) + 2Fe(s)
2NH3 +H2SO4=(NH4)2 SO4 Write the Ionic and net Ionic equation?

2NH3 +H2SO4=(NH4)2 SO4 Write the Ionic and net Ionic equation?

Ca(OH)2 +H2SO4 ---> CaSO4 +2H2O What is the net ionic equation ?with steps

Ca(OH)2 +H2SO4 ---> CaSO4 +2H2O What is the net ionic equation ?with steps
For the chemical reaction 2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq)2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq) write the net ionic equation, including the phases. net ionic equation:

For the chemical reaction 2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq)2HBr(aq)+Ba(OH)2(aq)⟶2H2O(l)+BaBr2(aq) write the net ionic equation, including the phases. net ionic equation:
Pick the redox reaction! I) H2SO4 + 2NH3 → (NH4)2SO4 II) H2SO4 + Na2CO3 → Na2SO4...

Pick the redox reaction! I) H2SO4 + 2NH3 → (NH4)2SO4 II) H2SO4 + Na2CO3 → Na2SO4 + H2O + CO2 III) 2H2SO4 + Cu → CuSO4 + 2H2O + SO2 IV) 2K2CrO4 + H2SO4 → K2Cr2O7 + K2SO4 + H2O

Write the full ionic and net ionic equation for the neutralization reaction of H2SO4 (aq) with...

Write the full ionic and net ionic equation for the neutralization reaction of H2SO4 (aq) with Ba(OH)2 (aq). Balanced Full ionic Net ionic