2NH3 +H2SO4=(NH4)2 SO4 Write the Ionic and net Ionic equation?
Answer:
Explanation:
Ionic Equation : An ionic equation is a chemical equation in which the electrolytes in aqueous solution are expressed as dissociated ions
Net Ionic Equation : The net ionic equation is a chemical equation for a reaction that lists only those species that participating in the reaction
Step to write ionic equation equation:
Step 1: Write the balanced chemical equation
2 NH3 (aq) + H2SO4 (aq) ---> (NH4)2SO4(aq)
Step 2: Write the complete ionic equation.
2 NH3 (aq) + 2 H+ (aq) + SO4-2 (aq) -----------> 2 NH4+ (aq) + SO4-2 (aq)
[ Here, Strong aqueous compounds will breaks and weak aqueous , solid,liquid and gaseous compound will remain unchanged. So H2SO4 (aq) and (NH4)2SO4(aq) wil breaks into ions but 2 NH3 (aq) is a weak aqueous compound and doen't dissolve completely ]
Step 3: Write the net ionic equation
[ net ionic equation is written by crossing out the spectator ions from the complete ionic equation ]
You can recognize spectator ions by looking for ions that are present on both sides of the equation. They will always have the same exact formula, charge, and physical state.
2 NH3 (aq) + 2 H+ (aq) + SO4-2 (aq) -----------> 2 NH4+ (aq) + SO4-2 (aq)
Final net ionic equation
2 NH3 (aq) + 2 H+ (aq) -----------> 2 NH4+ (aq)
since 2 is common for all the compound so tthe final net ionic equation will be written in reduced form will be
NH3 (aq) + H+ (aq) -----------> NH4+ (aq)
Write the complete ionic equation and the net ionic equation for each of the reactions: Co(NO3)2(aq) + K2CO3(aq) --> CoCO3(s) + 2KNO3(aq) AgNO3(aq) + CsI(aq) ---> AgI(s) + CsNO3(aq) KHCO3(aq) + KOH(aq) --> K2CO3(aq) + H2O(l) H2SO4(aq) + 2NH3(aq) --> (NH4)2SO4(aq) 3Mg(s) + 2FeCl3(aq) --> 3MgCl2(aq) + 2Fe(s)
For H2SO4(aq) + 2NH4OH(aq) --> (NH4)2SO4(aq)+2H2O what is the: Total Ionic equation: Specator Ions: Net Ionic equation:
Write the full ionic and net ionic equation for the neutralization reaction of H2SO4 (aq) with Ba(OH)2 (aq). Balanced Full ionic Net ionic
Write the balanced complete ionic equations and net ionic equations for the reactions that occur when each of the following solutions are mixed. (Type your answers using the format [NH4]+ for NH4+ or Ca3(PO4)2 for Ca3(PO4)2. Use the lowest possible coefficients.) (a) Pb(NO3)2(aq) and Na2S(aq) complete ionic equation? net ionic equation? (b) Al2(SO4)3(aq) and K3PO4(aq) complete ionic equation? net ionic equation? (c) (NH4)3PO4(aq) and CaCl2(aq) complete ionic equation? net ionic equation?
Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:
2,3,&4
2) Write a balanced net ionic equation for the reaction of H2SO4(ag) with Ba(OH)2(aq) A) 2 H+ (aq) + SO42-(aq) + Ba2+ (aq) + 2 OH-(aq) --BaSO4(s) + 2 H2001) B) Ba2+ (aq) + SO42-(aq) -BaSO46) C) H2SO4(aq) + Ba(OH)2(aq) -BaSO4(s) + 2 H20(1) D) H+ (aq) + OH+(aq) +2001 3) Write a balanced net ionic equation for the reaction of AgNO3(aq) with Cu(s). A) 2 AgNO3(aq) + Cu(s) - 2 Ag(s) + CUNO3(aq) B) AgNO3(aq) + Cu(s) -Ag(s)...
Write the net ionic equation for this precipitation reaction. Include physical states. (NH4)2CO3(aq)+Ca(ClO4)2(aq)⟶CaCO3(s)+2NH4ClO4(aq) net ionic equation:
Write a net ionic equation for calcium and sodium carbonate? Write a net ionic equation for Fe3+ and potassium ferrocyanide? Write the net ion equation for Fe3+ and potassium thiocyanate? Write the net ion equation for Ca2+ and (NH4)2C204?
Reaction in Aquesous
1. Write the balanced molecular equation, complete ionic equation, and net ionic equation for the following: (5 pts) HI + K2CO3 → Complete ionic equation: Net ionic equation: TURN OVER → 2. A 31.5mL aliquot of H2SO4 of unknown concentration was titrated with 0.0134M NaOH. It took 23.9mL of NaOH to reach the endpoint of the titration. What is the concentration of the H2SO4? (5 pts) 3. In the following reaction, indicate the substance being oxidized, reduced,...
2. Write the net ionic equation for the following. Which ions are spectator ions? (NH4)2CO3(aq) + Cu(NO3)2(aq) → CuC03(s) + 2 NH4NOg(aq)