Calculate the mass of CO2 produced (in grams) when 575 kJ of thermal energy are released....

Question

Question

Calculate the mass of CO₂ produced (in grams) when 575 kJ of thermal energy are released. Be sure to indicate the proper algebraic sign.

4CO(g) + 2NO₂(g) → 4CO₂(g) + N₂(g) ∆H°= -1198.2 kJ

science chemistry

Answer 1

Answer #1

When 4 moles of CO2 produced then 1198.2 kJ of heat will be released

Moles of CO2 used = 4 mol x 575 kJ / 1198.2 kJ = 1.919.54 mol

Molar mass of CO2 = 44 g/mol

Mass of CO2 used = 1.919.54 mol x 44 g/mol = 84.46 g

When 84.46 gm of CO2 produced, 575 kJ of thermal energy are released

Answer 2

Similar Homework Help Questions

Calculate the mass of CO2 produced in grams) when 575 kJ of thermal energy are released....

Calculate the mass of CO2 produced in grams) when 575 kJ of thermal energy are released. Be sure to indicate the proper algebraic sign. 4CO(g) + 2NO2(8) 4CO2(g) + N2(8) AHⓇ=-1198.2 kJ
Determine the mass of carbon doixide produced when 1500KJ of energy is released in the form...

Determine the mass of carbon doixide produced when 1500KJ of energy is released in the form of heat accoarding to the reaction below. CH2CO(g)+2O2(g)=2CO2+H2O(g) Delta H=-981.1 KJ
using the equation in sample problem 9.5, calculate the grams of CO2 that can be produced...

using the equation in sample problem 9.5, calculate the grams of CO2 that can be produced when 25.0 g of O2 reacts. v "Ing metals. 2CH2(g) + 502(g) -4CO2(g) + 2H2O(g)

8. Calculate the mass, in grams, of CO2 that can be produced by the reaction of...

8. Calculate the mass, in grams, of CO2 that can be produced by the reaction of 75.0 g of Cha with 50.0 g of O2(g). CH_(g) + O2(g) + CO2(g) + H2O(g)
Homework Thermochemistry Name: 1. Calculate the mass of O that is produced by photosynthesis when 2.49...

Homework Thermochemistry Name: 1. Calculate the mass of O that is produced by photosynthesis when 2.49 x 109 kJ of solar energy is consumed by the following reaction: 6 H20 (1) + 6 CO2 (g) - C&H 20(s) + 6 02 (g) ; AH-2803 kJ 2. Given the following thermochemical equation, what amount of energy is absorbed/given off when 255 g of CuO is reacted. 2 Cu20 (s) - 4 Cu (s) + O2(g) : AH = 333.8 kJ 3....
Calculate the heat released when 135 grams of ethanol C2H5OH, burns. The heat of combustion of...

Calculate the heat released when 135 grams of ethanol C2H5OH, burns. The heat of combustion of ethanol is 1233 kJ/mol. Molar mass of ethanol C2H5OH = 46.07 g/mol C2H5OH(g) + 3 O2(g) → 2 CO2 (g) + 3 H2O(l) LaTeX: \DeltaΔH = -1233 kJ/mol

How much heat energy (in kj) will be absorbed or released if 11.5 grams of ammonia...

How much heat energy (in kj) will be absorbed or released if 11.5 grams of ammonia is produced? State whether the energy will be absorbed or released?
12. Calculate the energy released, in kJ, when 1.00 mol U-238 isotopes (nuclear mass = 238.05078...

12. Calculate the energy released, in kJ, when 1.00 mol U-238 isotopes (nuclear mass = 238.05078 amu) decays via a particle emission to form thorium-234 (nuclear mass = 234.03596 amu). The nuclear mass of helium-4 is 4.002603 amu. The speed of light = 2.997925x108 m/s and 1 amu = 1.660538x10-24 g
If there are 2.36 g of NO present, how much energy (kJ) will be produced? 2...

If there are 2.36 g of NO present, how much energy (kJ) will be produced? 2 NO (g) → 2 N2 (g) + O2 (g) ΔH = -180.0 kJ If 3.50 kJ was required for the following reaction, how many grams of KClO3 was produced? 2 KCl (s) + 3 O2 (g) → 2 KClO3 (s) ΔH = 84.9 kJ If there are 0.709 mol of O2 present, how much energy (kJ) will be consumed when the reaction is reversed?...

QUESTIONS 10 points Save Answer When 50 grams of nitrogen gas, N2, react in the following...

QUESTIONS 10 points Save Answer When 50 grams of nitrogen gas, N2, react in the following reaction, how many kilojoules (kl) of energy are consumed? N2(g) + O2(g) 2NO(g) AH = 180 kj a. -321 kg b.321 k) c. 77.1 k) d.-77.1 k] QUESTION 9 10 points Save Answer When 35 grams of chlorine gas, Cl2, react in the following equation, how many kilojoules (kl) of energy are released? P4(s) + 10C12(g) 4PC15(5) AH - 1891 kJ a.-67.9 k) b.67.9...