How much Cu2S is needed to make 214.0 g Cu? How much SO2 is produced?

Question

Question

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

4. Consider the following reactions: Cu20 + Cu2S Cu+SO2 250 kg of copper (I) oxide is...

4. Consider the following reactions: Cu20 + Cu2S Cu+SO2 250 kg of copper (I) oxide is heated with 129 kg of copper () sulfide. A) Determine the limiting reagent [T/I - 3, C-1] B) How much copper is recovered in (g)? [T/I -2, C-1] C) How many grams of the excess reactant remains [T/I 3, C-1] Show all your work Cu7O 143.1 CurS 15
The copper mineral chalcocite (Cu2S) can be converted to copper by heating in air: Cu2S (s)...

The copper mineral chalcocite (Cu2S) can be converted to copper by heating in air: Cu2S (s) + O2 (g) -----------> 2Cu (s) + SO2 (g) How many grams of SO2 is produced?
2 Cu + S -> Cu2S What is the limiting reactant when 80.0g Cu reacts with...

2 Cu + S -> Cu2S What is the limiting reactant when 80.0g Cu reacts with 25.0g S? Based on the previous question, how many grams of Cu2S will be produced?

2. The Ksp of Cu2S is 1.0 x 10-48. What concentration of Cu+ (aq) is needed...

2. The Ksp of Cu2S is 1.0 x 10-48. What concentration of Cu+ (aq) is needed to begin precipitation of Cu>S(s) from a 2.0 x 10 15 m s%(ag) solution?
suppose an ore sample contains 10.0 impurity in addition to a mixture of cus and cu2s....

suppose an ore sample contains 10.0 impurity in addition to a mixture of cus and cu2s. Heating 100.0g of the mixture produces 76.2g of copper metal with a purity of 90.4%. What is the weight percent of cus of the ore? The percent of cu2s? Copper metal can be prepared by roasting copper ore, which can contain cuprite (CuzS) and copper(II) sulfide. Cu,S(s) + O2(g) + 2 Cu(s) + SO2(E) CuS(s) + O2(g) + Cu(s) + S02 (8) Suppose an...
how much sulfur dioxide SO2 can be produced by the combustion of 21 tons of sulfur...

how much sulfur dioxide SO2 can be produced by the combustion of 21 tons of sulfur (S)

How much water is produced when 0.0320 g of phosphoric acid reacts? Choose the answer with...

How much water is produced when 0.0320 g of phosphoric acid reacts? Choose the answer with the appropriate significant figures and unit. 0.0177 g H200) 0.0320 g H200) 0.0580 g H3PO4(aq) 0.018 g H200) 0.058 g H3PO4(aq) Cu(s) + 2AgNO3(aq) → 2Ag(s) + Cu(NO3)2(aq) Calculate the mass of copper needed to react with 5.7120 g AgNOa(aq). Choose the answers with the appropriate significant figures and unit. Selectl Select )
QUESTION 1 How many grams of NaCl are needed if we want to make 9.025 moles...

QUESTION 1 How many grams of NaCl are needed if we want to make 9.025 moles of AgCl by the reaction NaCl + AgNO3 ———> AgCl + NaNO3 QUESTION 2 How many grams of O 2 would be needed to react with 3.933 moles of CS 2 in the reaction CS2 + 3 O2 ———> CO2 + 2 SO2 QUESTION 3 How many grams of PbSO 4 will be produced if we produce 25.59 grams of NaNO 3 in the reaction Pb(NO 3) 2 + Na 2SO 4 ———> PbSO 4 + 2 NaNO 3 QUESTION 4 How...
Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)

Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)

How much heat energy is required to convert 62.8 g of liquid sulfur dioxide, SO2, at...

How much heat energy is required to convert 62.8 g of liquid sulfur dioxide, SO2, at 219.4 K to gaseous SO2 at 263.1 K if the molar heat of vaporization of SO2 is 24.9 kJ/mol, and the specific heat capacity (C) of liquid SO2 is 1.36 J/(g ·°C)?