Here is a balanced chemical reaction for the combustion of Glucose: C6H12O6(s) + 6O2(g) -->6CO2(g) +...
Here is a balanced chemical reaction for the combustion of Glucose: C6H12O6(s) + 6O2(g) -->6CO2(g) + 6H2O(g).
Calculate the electrical current a human body experiences from the combustion of 300 grams of glucose per day. (Hint - first fond the moles of electrons transferred in the reaction)
Use the equation: mass = (I)(t)/F x (M)/(n)
n = moles of e- transferred
M = molar mass of glucose
I = Current (amps)
t = time (s)
F = Faraday's Constant
mass = 300 grams given
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Here is a balanced chemical reaction for the combustion of
Glucose: C6H12O6(s) + 6O2(g) -->6CO2(g) +...
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH...
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801.65 kJmol1. Estimate AGğ10 298
Glucose, C6H12O6,C6H12O6, is used as an energy source by the human body. The overall reaction in...
Glucose, C6H12O6,C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equation C6H12O6(aq)+6O2(g)⟶6CO2(g)+6H2O(l)C6H12O6(aq)+6O2(g)⟶6CO2(g)+6H2O(l) Calculate the number of grams of oxygen required to convert 13.0 g13.0 g of glucose to CO2CO2 and H2O.H2O.
Question 1 Glucose metabolism can be represented by the following chemical reaction: C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l) H for...
Question 1
Glucose metabolism can be represented by the following chemical
reaction:
C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l)
H for the
reaction is -2837 kJ/mole.
Is this reaction endothermic or exothermic?
Write an expression for the equilibrium constant for this
reaction.
Given that the value of the equilibrium constant is very large,
would you expect this reaction to be fast or slow?
Explain the effect on equilibrium of
Increasing temperature
Increasing pressure by decreasing the volume
Decreasing concentration of oxygen
Increasing the concentration of...
The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−lightC6H12O6+6O2 If a plant produces 7.86...
The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−lightC6H12O6+6O2 If a plant produces 7.86 mol of C6H12O6, how many moles of CO2 are needed?
6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please
6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please
Which of the following processes are exothermic? i. C6H12O6 + 6O2(g) → 6CO2(g) + 6H2O(g) ii....
Which of the following processes are exothermic? i. C6H12O6 + 6O2(g) → 6CO2(g) + 6H2O(g) ii. H2(g) → 2H(g) iii. CO2(s) → CO2(g)
Glucose, C6H12O6, is used as an energy source by the human body.
Glucose, C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equationC6H12O6(aq) + 6O2(g) — 6CO2(g) + 6H2O(1) Calculate the number of grams of oxygen required to convert 38.0 g of glucose to CO2, and H2O. mass of O2 = _______ g Calculate the number of grams of CO2, produced. mass of CO2 = _______ g
Given the thermochemical equation for photosynthesis, 6H2O(l) + 6CO2(g) → C6H12O6(s) + 6O2(g) ΔH = +2803...
Given the thermochemical equation for photosynthesis, 6H2O(l) + 6CO2(g) → C6H12O6(s) + 6O2(g) ΔH = +2803 kJ/mol Calculate the solar energy required to produce 4574 g of C6H12O6. Be sure to answer is scientific notation.
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy...
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy of formation data, determine which of the following reactions is more energetically favorable. .
Calculate the amount of energy released as heat at constant pressure when 1.00 g of glucose...
Calculate the amount of energy released as heat at constant pressure when 1.00 g of glucose undergoes a combustion reaction according to the equation below: C6H12O6(s) + 6O2(g) ® 6CO2(g) + 6H2O(g) ∆rHϴ = –2806 kJ (A) 16.00 kJ (B) 156.0 kJ (C) 468.0 kJ (D) 2806 kJ (E) 505600 kJ
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801.65 kJmol1. Estimate AGğ10 298
Question 1
Glucose metabolism can be represented by the following chemical
reaction:
C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l)
H for the
reaction is -2837 kJ/mole.
Is this reaction endothermic or exothermic?
Write an expression for the equilibrium constant for this
reaction.
Given that the value of the equilibrium constant is very large,
would you expect this reaction to be fast or slow?
Explain the effect on equilibrium of
Increasing temperature
Increasing pressure by decreasing the volume
Decreasing concentration of oxygen
Increasing the concentration of...
Glucose, C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equationC6H12O6(aq) + 6O2(g) — 6CO2(g) + 6H2O(1) Calculate the number of grams of oxygen required to convert 38.0 g of glucose to CO2, and H2O. mass of O2 = _______ g Calculate the number of grams of CO2, produced. mass of CO2 = _______ g
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 10 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 10 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 10 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 10 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 10 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 10 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 10 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 10 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 10 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 10 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 10 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 10 months ago