1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH...

Question

Question

1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801

science chemistry

Answer 1

Answer #1

(inte! Date: CH12O6 (s) + 60, 600, + 6H₂0 (1) - According to Grubby Helmholtz equation AH AG - T (DAG) - Har = - 2801.65 kJ/m

Answer 2

Similar Homework Help Questions

Here is a balanced chemical reaction for the combustion of Glucose: C6H12O6(s) + 6O2(g) -->6CO2(g) +...

Here is a balanced chemical reaction for the combustion of Glucose: C6H12O6(s) + 6O2(g) -->6CO2(g) + 6H2O(g). Calculate the electrical current a human body experiences from the combustion of 300 grams of glucose per day. (Hint - first fond the moles of electrons transferred in the reaction) Use the equation: mass = (I)(t)/F x (M)/(n) n = moles of e- transferred M = molar mass of glucose I = Current (amps) t = time (s) F = Faraday's Constant mass...
Given the thermochemical equation for photosynthesis, 6H2O(l) + 6CO2(g) → C6H12O6(s) + 6O2(g) ΔH = +2803...

Given the thermochemical equation for photosynthesis, 6H2O(l) + 6CO2(g) → C6H12O6(s) + 6O2(g) ΔH = +2803 kJ/mol Calculate the solar energy required to produce 4574 g of C6H12O6. Be sure to answer is scientific notation.
.corre YouTube Popular Imported From Sa... 3. The combustion of the sugar glucose, C6H12O6, is described...

.corre YouTube Popular Imported From Sa... 3. The combustion of the sugar glucose, C6H12O6, is described by the following equation: C6H1206(s) + 602(g) - 6CO2(g) + 6H20(1) AH = -2816 kJ How much heat in kilojoules can be produced by the metabolism of 1.0 g of glucose in the human body? 5 2

Question 1 Glucose metabolism can be represented by the following chemical reaction: C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l) H for...

Question 1 Glucose metabolism can be represented by the following chemical reaction: C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l) H for the reaction is -2837 kJ/mole. Is this reaction endothermic or exothermic? Write an expression for the equilibrium constant for this reaction. Given that the value of the equilibrium constant is very large, would you expect this reaction to be fast or slow? Explain the effect on equilibrium of Increasing temperature Increasing pressure by decreasing the volume Decreasing concentration of oxygen Increasing the concentration of...
Which of the following processes are exothermic? i. C6H12O6 + 6O2(g) → 6CO2(g) + 6H2O(g) ii....

Which of the following processes are exothermic? i. C6H12O6 + 6O2(g) → 6CO2(g) + 6H2O(g) ii. H2(g) → 2H(g) iii. CO2(s) → CO2(g)
6CO2 + 6H20 → C6H12O6 + 602 Glucose Oxygen Carbon Dioxide Water What type of energy...

6CO2 + 6H20 → C6H12O6 + 602 Glucose Oxygen Carbon Dioxide Water What type of energy needs to be added to make this reaction occur?

a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy...

a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy of formation data, determine which of the following reactions is more energetically favorable. .
The respiration of 1 mole of glucose is represented by the following equation C6H12O6 + 6O2...

The respiration of 1 mole of glucose is represented by the following equation C6H12O6 + 6O2 --> 6CO2 + 6H2O + 686 Kcal Where is the energy that is released or absorbed (depends on the reaction) found?
6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please

6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please

Glucose, C6H12O6, is used as an energy source by the human body.

Glucose, C6H12O6, is used as an energy source by the human body. The overall reaction in the body is described by the equationC6H12O6(aq) + 6O2(g) — 6CO2(g) + 6H2O(1) Calculate the number of grams of oxygen required to convert 38.0 g of glucose to CO2, and H2O. mass of O2 = _______ g Calculate the number of grams of CO2, produced. mass of CO2 = _______ g