Which of the following processes are exothermic? i. C6H12O6 + 6O2(g) → 6CO2(g) + 6H2O(g) ii....
Which of the following processes are exothermic?
i. C6H12O6 + 6O2(g) → 6CO2(g) + 6H2O(g)
ii. H2(g) → 2H(g)
iii. CO2(s) → CO2(g)
Homework Answers
Add Answer to:
Which of the following processes are exothermic?
i. C6H12O6 + 6O2(g)
→ 6CO2(g) + 6H2O(g)
ii....
6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please
6CO2(g)+6H2O(l)+15MJ→C6H12O6(aq)+6O2(g) ? is this exothermic reaction or endothermic reaction? ASAP please
Given the thermochemical equation for photosynthesis, 6H2O(l) + 6CO2(g) → C6H12O6(s) + 6O2(g) ΔH = +2803...
Given the thermochemical equation for photosynthesis, 6H2O(l) + 6CO2(g) → C6H12O6(s) + 6O2(g) ΔH = +2803 kJ/mol Calculate the solar energy required to produce 4574 g of C6H12O6. Be sure to answer is scientific notation.
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy...
a.) C6H12 O6(s) +6O2(g) ----> 6H2O(l) + 6CO2 b.) C6H12O6(s)----> 3CH4(g) + 3CO2(g) using free energy of formation data, determine which of the following reactions is more energetically favorable. .
Question 1 Glucose metabolism can be represented by the following chemical reaction: C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l) H for...
Question 1
Glucose metabolism can be represented by the following chemical
reaction:
C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l)
H for the
reaction is -2837 kJ/mole.
Is this reaction endothermic or exothermic?
Write an expression for the equilibrium constant for this
reaction.
Given that the value of the equilibrium constant is very large,
would you expect this reaction to be fast or slow?
Explain the effect on equilibrium of
Increasing temperature
Increasing pressure by decreasing the volume
Decreasing concentration of oxygen
Increasing the concentration of...
The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−lightC6H12O6+6O2 If a plant produces 7.86...
The reaction for producing glucose in plants, called photosynthesis, is 6CO2+6H2O−→−−lightC6H12O6+6O2 If a plant produces 7.86 mol of C6H12O6, how many moles of CO2 are needed?
Here is a balanced chemical reaction for the combustion of Glucose: C6H12O6(s) + 6O2(g) -->6CO2(g) +...
Here is a balanced chemical reaction for the combustion of Glucose: C6H12O6(s) + 6O2(g) -->6CO2(g) + 6H2O(g). Calculate the electrical current a human body experiences from the combustion of 300 grams of glucose per day. (Hint - first fond the moles of electrons transferred in the reaction) Use the equation: mass = (I)(t)/F x (M)/(n) n = moles of e- transferred M = molar mass of glucose I = Current (amps) t = time (s) F = Faraday's Constant mass...
1) the photosynthetic conversion of co2 to o2 can be represented by 6co2 + 6h2o <>c6h12o6+6o2...
1) the photosynthetic conversion of co2 to o2 can be represented by 6co2 + 6h2o <>c6h12o6+6o2 what is the equilibrium expression for this reaction? 2) what is the state of the system if I2=1.0 M and I=1.0×10^-3 M I2 <>2I. kc=3.8×10^-5 a. the system is at equilibrium b. the system is at a steady state c. the system is not at equilibrium and will produce more reactants d. the system is not at equilibrium and will produce more products 3)...
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH...
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801.65 kJmol1. Estimate AGğ10 298
The respiration of 1 mole of glucose is represented by the following equation C6H12O6 + 6O2...
The respiration of 1 mole of glucose is represented by the following equation C6H12O6 + 6O2 --> 6CO2 + 6H2O + 686 Kcal Where is the energy that is released or absorbed (depends on the reaction) found?
A scientist measures the standard enthalpy change for the following reaction to be 2752.8 kJ : 6CO2(g) + 6H2O(1)...
A scientist measures the standard enthalpy change for the following reaction to be 2752.8 kJ : 6CO2(g) + 6H2O(1) C6H12O6 + 6 O2(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of CH1:05 is kJ/mol A scientist measures the standard enthalpy change for the following reaction to be 53.9 LJ: CO2(g) + H2(g)— CO(g) + H2O() Based on this value and the standard enthalpies of formation for the other...
Question 1
Glucose metabolism can be represented by the following chemical
reaction:
C6H12O6(aq)+6O2(g)6CO2(g)+6H2O(l)
H for the
reaction is -2837 kJ/mole.
Is this reaction endothermic or exothermic?
Write an expression for the equilibrium constant for this
reaction.
Given that the value of the equilibrium constant is very large,
would you expect this reaction to be fast or slow?
Explain the effect on equilibrium of
Increasing temperature
Increasing pressure by decreasing the volume
Decreasing concentration of oxygen
Increasing the concentration of...
1. Consider the combustion of a-D glucose. C6H12O6(s)6O2(g)6CO2(g)+6H20() It is given that AG298 -2878.92 kJmol1 and AH -2801.65 kJmol1. Estimate AGğ10 298
A scientist measures the standard enthalpy change for the following reaction to be 2752.8 kJ : 6CO2(g) + 6H2O(1) C6H12O6 + 6 O2(g) Based on this value and the standard enthalpies of formation for the other substances, the standard enthalpy of formation of CH1:05 is kJ/mol A scientist measures the standard enthalpy change for the following reaction to be 53.9 LJ: CO2(g) + H2(g)— CO(g) + H2O() Based on this value and the standard enthalpies of formation for the other...
Most questions answered within 3 hours.
-
Where is the error in this code sequence?
String s1 = "Hello";
String s2 = "ello";...
asked 11 months ago -
Financial data for Joel de Paris, Inc., for last year
follow:
Joel de Paris, Inc.
Balance...
asked 11 months ago -
Consider this reaction:
Al2(SO4)3 (aq)+ BaCl3
(aq) Al2Cl6 (aq)- +
3BaSO4(s) . What is the...
asked 11 months ago -
Suppose that Savneet is considering increasing her
recent random sample from 20 car rentals to 40...
asked 11 months ago -
Trucks arrive at an unloading terminal at an average rate of 120
per hour.
Trucks arrive...
asked 11 months ago -
Why are methanol and ethanol completely soluble in water while
octanol is not very little soluble....
asked 11 months ago -
A facilities manager at a university reads in a research report
that the mean amount of...
asked 11 months ago -
When the CuSO4 is rehydrated by adding water to the anhydrous
compound, is this an endothermic...
asked 11 months ago -
A ray of sunlight is passing from diamond into crown glass; the
angle of incidence is...
asked 11 months ago -
A block of mass 0.249 kg is placed on top of a light, vertical
spring of...
asked 11 months ago -
how do the kidneys compensate in the presences of acidosis
a) trigger hyperventilate
b) reserve acid...
asked 11 months ago -
Question 501 pts
The rental rate of capital to the firm increases. Which of the
following...
asked 11 months ago