a) Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation:
12N2(g)+O2(g)→NO2(g), ΔfH∘A=33.2 kJ mol−1
12N2(g)+12O2(g)→NO(g), ΔfH∘B=90.2 kJ mol−1
Express your answer with the appropriate units.
b) Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information:
B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔrH∘A=+2035 kJ mol−1
2B(s)+3H2(g)→B2H6(g), ΔrH∘B=+36 kJ mol−1
H2(g)+12O2(g)→H2O(l), ΔrH∘C=−285 kJ mol−1
H2O(l)→H2O(g), ΔrH∘D=+44 kJ mol−1
a) Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation:...
Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation: 12N2(g)+O2(g)→NO2(g), ΔH∘A=33.2 kJ 12N2(g)+12O2(g)→NO(g), ΔH∘B=90.2 kJ Express your answer with the appropriate units. Part B Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ Express your answer with the appropriate units.
Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ
Calculate the enthalpy of the reaction 2NO(g) + O2(g)2NO2(g) Hess's law states that "the heat released or absorbed in a chemical process is the same whether the process takes place in one or in several steps." It is important to recall the following rules: given the following reactions and enthalpies of formation: 1. ¢ N2(g) + O2(g)+NO2(g), AH; = 33.2 kJ 2. N2(g) + O2(g) NO(g), AHB = 90.2 kJ 1. When two reactions are added, their enthalpy values are...
Calculate the enthalpy of the reaction 2NO(g) + O2(g) +2NO2 (g) given the following reactions and enthalpies of formation: 1;N, (g) +0,(g)NO,(g), AH = 33.2 kJ 2 N2(g) + O2(g) →NO(g), AHg = 90.2 kJ Express your answer with the appropriate units. View Available Hint(s) AH'- Value Units Submit
Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) Given the following reactions and enthalpies of formation: N2(g) + 2O2(g)→ 2NO2(g), ΔH∘ = 66.4kJ N2(g)+ O2(g)→ 2 NO(g), ΔH∘=180.4 kJ Please explain the steps as well!
(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from the elements as: 2B (s) + 3H2 (g) → B2H6 (g) Use the following data: 4B (s) + 3O2 (g) → 2B2O. (S) Δ? = -2546 kJ mol-1 B2H6 (g) + 3O2 (g) → B2O3 (s) + 3H2O (g) Δ? = -2035 kJ mol-1 2H2 (g) + O2 (g) → 2H2O (l) Δ? = -572 kJ mol-1 H2O (l) →...
1)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ/mol Calculate the amount of heat released when 37.1 g of diborane is burned. 2) Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ How much heat is released when a mixture of 9.71 g B2H6 and 1.53 g O2 is burned? 3)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ...
Calculate the enthalpy of the reaction: 2 NO(g) + O2(g) --> 2 NO2(g) given the following reactions and enthalpies of formation: 1/2 N2(g) + O2(g) → NO2(g), ΔH = 33.2 kJ 1/2 N2(g) + 1/2 O2(g) → NO(g), ΔH = 90.2 kJ
Consider the following thermal equations: 2B (s) + 3H2(g) ⟶ B2H6 (g) ΔH = +36kJ/mol 2B (s) + 3/2O2 (g) ⟶ B2O3 (s) ΔH = −1273 kJ/mol H2 (g) + 1/2O2 (g) ⟶ H2O (l) ΔH = −286 kJ/mol H2O (l) ⟶ H2O (g) ΔH = +44 kJ/mol Calculate ΔH for the combustion of borane, B2H6 (g) + 3O2 (g) ⟶ B2O3 (s) + 3H2O (g)
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=