1)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ/mol...

Question

Question

1)Consider the reaction

B₂H₆(g) + 3 O₂(g) → B₂O₃(s) + 3 H₂O(g) ∆H = -2035 kJ/mol

Calculate the amount of heat released when 37.1 g of diborane is burned.

2) Consider the reaction

B₂H₆(g) + 3 O₂(g) → B₂O₃(s) + 3 H₂O(g) ∆H = -2035 kJ

How much heat is released when a mixture of 9.71 g B₂H₆ and 1.53 g O₂ is burned?

3)Consider the reaction

B₂H₆(g) + 3 O₂(g) → B₂O₃(s) + 3 H₂O(g) ∆H = -2035 kJ

How much heat is released when a mixture of 9.71 g B₂H₆ and 1.53 g O₂ is burned?

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ How much heat is released when a mixture of 8.26 g B2H7 and 8.80 g 02 is burned? heat released = kJ Submit Show Hints
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol...

Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol Calculate the amount of heat released when 54.4 g of diborane is burned, heat released = kJ

(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from th...

(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from the elements as: 2B (s) + 3H2 (g) → B2H6 (g) Use the following data: 4B (s) + 3O2 (g) → 2B2O. (S) Δ? = -2546 kJ mol-1 B2H6 (g) + 3O2 (g) → B2O3 (s) + 3H2O (g) Δ? = -2035 kJ mol-1 2H2 (g) + O2 (g) → 2H2O (l) Δ? = -572 kJ mol-1 H2O (l) →...
Consider the following thermal equations: 2B (s) + 3H2(g) ⟶ B2H6 (g) ΔH = +36kJ/mol 2B (s)...

Consider the following thermal equations: 2B (s) + 3H2(g) ⟶ B2H6 (g) ΔH = +36kJ/mol 2B (s) + 3/2O2 (g) ⟶ B2O3 (s) ΔH = −1273 kJ/mol H2 (g) + 1/2O2 (g) ⟶ H2O (l) ΔH = −286 kJ/mol H2O (l) ⟶ H2O (g) ΔH = +44 kJ/mol Calculate ΔH for the combustion of borane, B2H6 (g) + 3O2 (g) ⟶ B2O3 (s) + 3H2O (g)
For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react excess B2O3 with 25.0 g of H2O

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(...

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ
a) Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation:...

a) Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation: 12N2(g)+O2(g)→NO2(g), ΔfH∘A=33.2 kJ mol−1 12N2(g)+12O2(g)→NO(g), ΔfH∘B=90.2 kJ mol−1 Express your answer with the appropriate units. b) Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔrH∘A=+2035 kJ mol−1 2B(s)+3H2(g)→B2H6(g), ΔrH∘B=+36 kJ mol−1 H2(g)+12O2(g)→H2O(l), ΔrH∘C=−285 kJ mol−1 H2O(l)→H2O(g), ΔrH∘D=+44 kJ mol−1
Pentaborane B5H9 (s) burns vigorously in O2 to give B2O3 and H2O.

Pentaborane B5H9 (s) burns vigorously in O2 to give B2O3 and H2O. Calculate H*rxn for the combustion of 1 mol of B5H9.H*f [B2O3(s)] = -1273.5 kJ/molH*f [B5H9(s)] = 73.2 kJ/molH*f [H2O(l)] = -285.8 kJ/molI believe the answer is -4543 kJ/mol , but I don't know how to get it.

Consider the following reaction: C2H2 (g)+ O2 (g) → 2 CO2 (g) + H2O (g) Given...

Consider the following reaction: C2H2 (g)+ O2 (g) → 2 CO2 (g) + H2O (g) Given of CO2 (g) = -393.5 KJ/mol, H2O (g) = -241.8 KJ/mol, and for C2H2 (g) = 227.4 KJ/mol, calculate for this reaction. How many KJ of heat is released when 0.440 kg of carbon dioxide produced?