CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...

Question

Question

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ How much heat is released when a mixture o

science chemistry

Answer 1

Answer #1

molt 8.26 g gimin 0.20 mol Molar mass of O2 = mori gro مه 8.80 g 0.275 mol O2 AB2 HG (9) + 30₂ (9) > B2O3 (9) + 3H2O(g) Molar

Answer 2

Similar Homework Help Questions

1)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ/mol...

1)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ/mol Calculate the amount of heat released when 37.1 g of diborane is burned. 2) Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ How much heat is released when a mixture of 9.71 g B2H6 and 1.53 g O2 is burned? 3)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ...
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol...

Consider the reaction B_2H_6(g) + 3 O_2(g) rightarrow B_2O_3(s) + 3 H_2O(g) Delta H= -2035 kJ/mol Calculate the amount of heat released when 54.4 g of diborane is burned, heat released = kJ

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(...

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ
Consider the following thermal equations: 2B (s) + 3H2(g) ⟶ B2H6 (g) ΔH = +36kJ/mol 2B (s)...

Consider the following thermal equations: 2B (s) + 3H2(g) ⟶ B2H6 (g) ΔH = +36kJ/mol 2B (s) + 3/2O2 (g) ⟶ B2O3 (s) ΔH = −1273 kJ/mol H2 (g) + 1/2O2 (g) ⟶ H2O (l) ΔH = −286 kJ/mol H2O (l) ⟶ H2O (g) ΔH = +44 kJ/mol Calculate ΔH for the combustion of borane, B2H6 (g) + 3O2 (g) ⟶ B2O3 (s) + 3H2O (g)
5. (20 pts) Consider the following reaction OF2(g) + H2O(g) ---> 2 HF(g) + O2(g) AH.(kJ/mole)=-318 kJ/mole (a) U...

5. (20 pts) Consider the following reaction OF2(g) + H2O(g) ---> 2 HF(g) + O2(g) AH.(kJ/mole)=-318 kJ/mole (a) Using this information along with data in the appendix of your textbook, calculate AH (OF,(g)) in kJ/mole at 25°C. (b) If 15.0 g of OF2(g) and 10.0 g of H2Og) react, how much heat, expressed in kJ is released? Hint: First calculate the limiting reagent.

How much heat is released if 715 g Cao(s) is added to 152 g of H2O()?...

How much heat is released if 715 g Cao(s) is added to 152 g of H2O()? CAO(s) + H2O() - Ca(OH)2(s) AH an - -64.8 kJ/moll 0 768 kJ 0 8.26 0 0 508 ku 0 547) 0 555)
5. (20 pts) Consider the following reaction OF2(g) + H2O(g) ---> 2 HF(g) + O2(g) AH.(kJ/mole) -318 kJ/mole (a) U...

5. (20 pts) Consider the following reaction OF2(g) + H2O(g) ---> 2 HF(g) + O2(g) AH.(kJ/mole) -318 kJ/mole (a) Using this information along with data in the appendix of your textbook, calculate AH;(OF,(8)) in kJ/mole at 25°C. (b) If 15.0 g of OF2(g) and 10.0 g of H2Og) react, how much heat, expressed in kJ is released? Hint: First calculate the limiting reagent. 6.(20 pts) Consider two Styrofoam coffee cups. If cup #1 contains 102.0 mL of water at 81.8°C...
At 25°C, the following heats of reaction are known: AH (kJ/mol 167.4 2CIF + 02 →Cl20...

At 25°C, the following heats of reaction are known: AH (kJ/mol 167.4 2CIF + 02 →Cl20 + F20 2ClF3 + 202 →Cl20+3F20 341.4 2F2 + 02 → 2F20 At the same temperature, calculate ΔH for the reaction: ClF + F2 → CIF3 -43.4 A. -217.5 kJ/mol B.-130.2 kJ/mol C. +217.5 kJ/mol ○ D.-108.7 kJ/mol E. none of these QUESTION 4 Consider the reaction: When a 12.9-g sample of ethyl alcohol(molar mass 46.07 g/mol) is burned, how much energy is released...

How much heat is released if 7.15 g Cao(s) is added to 152 g of H2O(l)?! Cao(s) + H2O) - Ca(OH)2(s) AHxn = -64.8 kJ...

How much heat is released if 7.15 g Cao(s) is added to 152 g of H2O(l)?! Cao(s) + H2O) - Ca(OH)2(s) AHxn = -64.8 kJ/mol Select one: a. 7.68 kJ O b.8.26 kJ O c. 508 kJ d. 547 kJ O e. 555 kJ