For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

Question

Question

For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ

How much energy is needed to react excess B2O3 with 25.0 g of H2O

science chemistry

Answer 1

Answer #1

Answer:- Energy needed = 941.6 kJ

Solution:-

B₂O₃(s) + 3H₂O(g) ---> B₂H₆(g) + 3O₂(g) ΔH = 2035 kJ

This means 2035 kJ of energy is needed to react excess B₂O₃ with 25.0 g of H₂O

Lets convert 25.0 g of H₂O into moles

Number of moles = weight/molecular weight = 25/ 18.01 = 1.38812 moles

1 mole of B₂O₃ reacts with 3 mole of H₂O

so that

0.46271 mole of B₂O₃ reacts with 1.38812 mole of H₂O

Energy needed = 0.46271 * 2035

Energy needed = 941.6 kJ

Answer 2

Similar Homework Help Questions

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(...

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ
1)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ/mol...

1)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ/mol Calculate the amount of heat released when 37.1 g of diborane is burned. 2) Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ How much heat is released when a mixture of 9.71 g B2H6 and 1.53 g O2 is burned? 3)Consider the reaction B2H6(g) + 3 O2(g) → B2O3(s) + 3 H2O(g) ∆H = -2035 kJ...
Applications 4.85 How many g of B_Ho will react with 3.00 mol of Oz? B2H6(1) +...

Applications 4.85 How many g of B_Ho will react with 3.00 mol of Oz? B2H6(1) + 302(8)—>B2O3(s) + 3H2O(l)

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Consider the following thermal equations: 2B (s) + 3H2(g) ⟶ B2H6 (g) ΔH = +36kJ/mol 2B (s)...

Consider the following thermal equations: 2B (s) + 3H2(g) ⟶ B2H6 (g) ΔH = +36kJ/mol 2B (s) + 3/2O2 (g) ⟶ B2O3 (s) ΔH = −1273 kJ/mol H2 (g) + 1/2O2 (g) ⟶ H2O (l) ΔH = −286 kJ/mol H2O (l) ⟶ H2O (g) ΔH = +44 kJ/mol Calculate ΔH for the combustion of borane, B2H6 (g) + 3O2 (g) ⟶ B2O3 (s) + 3H2O (g)
QUESTION 13 How many grams 02 needed to react completely with 45.2 grams B2H6, according to...

QUESTION 13 How many grams 02 needed to react completely with 45.2 grams B2H6, according to the following balanced equation? B2H6 + 302 -> B2O3 + 3H20 1.93 g 4.959 0.05949 1579 3.08 9 0.4989 2.32 0.780 9

(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from th...

(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from the elements as: 2B (s) + 3H2 (g) → B2H6 (g) Use the following data: 4B (s) + 3O2 (g) → 2B2O. (S) Δ? = -2546 kJ mol-1 B2H6 (g) + 3O2 (g) → B2O3 (s) + 3H2O (g) Δ? = -2035 kJ mol-1 2H2 (g) + O2 (g) → 2H2O (l) Δ? = -572 kJ mol-1 H2O (l) →...
CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ How much heat is released when a mixture of 8.26 g B2H7 and 8.80 g 02 is burned? heat released = kJ Submit Show Hints
Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH a) This reaction is... Select one...

Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH a) This reaction is... Select one or more: a. exothermic b. endothermic

Consider the reaction: C2H5OH(L) + 3O2(G) -> 2CO2(G) +3H2O(L), Change in H= -1.37*10^3 Kj When a...

Consider the reaction: C2H5OH(L) + 3O2(G) -> 2CO2(G) +3H2O(L), Change in H= -1.37*10^3 Kj When a 16.0-g sample of ethyl alcohol (molar mass = 46.07 g/mol) is burned, how much energy is released as heat? A) 0.347 kJ B) 0.476 kJ C) 2.19 × 104 kJ D) 4.76 × 102 kJ E) 2.88 kJ