Balance the equation: H2SO4(aq)+ Ba(OH)2(aq) >>> H2O(l)+ BaSO4(s) Please Show how to solve. Thanks!

Question

Question

Balance the equation:

____H2SO4(aq)+ ____Ba(OH)2(aq) >>> ____ H2O(l)+ ____BaSO4(s)

Please Show how to solve.

Thanks!

science chemistry

Answer 1

Answer #1

Answer 2

Similar Homework Help Questions

PLEASE SHOW STEPS TO BALANCE EQUATION: Mg(OH)2(AQ)+2HBr(AQ)---->MgBr2(AQ)+2H2O(L)

PLEASE SHOW STEPS TO BALANCE EQUATION: Mg(OH)2(AQ)+2HBr(AQ)---->MgBr2(AQ)+2H2O(L)
The following equation can be classified as what type(s) of reaction(s)? Al(OH)3(aq)+H2SO4(aq)~ Al2(SO4)3(s)+H2O(l) balance the equation.

The following equation can be classified as what type(s) of reaction(s)? Al(OH)3(aq)+H2SO4(aq)~ Al2(SO4)3(s)+H2O(l) balance the equation.
Balance the following chemical equation? Ca(OH)2(aq)+HNO3(aq)→H2O(l)+Ca(NO3)2(aq) Express your answer as a chemical equation. Identify all of...

Balance the following chemical equation? Ca(OH)2(aq)+HNO3(aq)→H2O(l)+Ca(NO3)2(aq) Express your answer as a chemical equation. Identify all of the phases in your answer?

Balance the following equation: Al(s) + KOH(aq) + H2SO4(aq) + H2O(l) ---> KAl(SO4)2 * 12 H2O(s) + H2(g)

Balance the following equation: Al(s) + KOH(aq) + H2SO4(aq) + H2O(l) ---> KAl(SO4)2 * 12 H2O(s) + H2(g)
Consider the following unbalanced equation: H3PO4(aq) + Ca(OH)2(s) → H2O(l) + Ca3(PO4)2(s) If 34.1 moles of...

Consider the following unbalanced equation: H3PO4(aq) + Ca(OH)2(s) → H2O(l) + Ca3(PO4)2(s) If 34.1 moles of H3PO4(aq) reacts with an excess of Ca(OH)2(s), what is the theoretical yield of H2O(l) in moles? O 6.34x102 moles 6.42x102 moles 1.02x102 moles 8.34x102 moles 8.37x102 moles 0 O
6a. Balance the equation: HNO3 (aq) + Ba(OH)2 (aq)--> -H2O() + Ba(NO3)2 (aq) 6b. If 0.295...

6a. Balance the equation: HNO3 (aq) + Ba(OH)2 (aq)--> -H2O() + Ba(NO3)2 (aq) 6b. If 0.295 moles of Ba(OH)2 are used, how many moles of Ba(NO)2 will be produced ? 6c. If 0.295 moles of Ba(OH)2 are used, how many grams of Ba(NO,)2 will be produced ? 6d. If 0.295 moles of HNO, are used, how many grams of H,0 can be produced?

Given: 1) NaOH Na+(aq) + OH- (aq) 2) NaOH + H+ Cl-(aq) H2O(l) + Na+(aq) +...

Given: 1) NaOH Na+(aq) + OH- (aq) 2) NaOH + H+ Cl-(aq) H2O(l) + Na+(aq) + Cl-(aq) 3) Na+(aq) + OH-(aq) + H+(aq) + Cl-(aq) H2O(l) + Na+(aq) + Cl-(aq) Show that equations 1 and 3 can be added algebraically to give equation 2. We were unable to transcribe this imageWe were unable to transcribe this imageWe were unable to transcribe this image
Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e-...

Delete water and hydroxide where it is not needed and add in the appropriate coefficients. NiO2(s)+H2O(l)+OH-(aq)+e- ----> Ni(OH)2(s)+H2O(l)+OH-(aq) Express the reduction as a chemical equation including phases and electrons.
The net ionic hydrolysis equation for aqueous ammonium ethanoate is NH4CH3COO(aq)⇄NH4+(aq)+CH3COO-(aq) NH4OH(aq)+CH3COOH(aq)⇄NH4CH3COO(aq)+H2O(l) H2O(l)⇄H+(aq)+OH-(aq) NH4CH3COO(aq)+H2O(l)⇄NH4OH(aq)+CH3COOH(aq)

The net ionic hydrolysis equation for aqueous ammonium ethanoate is NH4CH3COO(aq)⇄NH4+(aq)+CH3COO-(aq) NH4OH(aq)+CH3COOH(aq)⇄NH4CH3COO(aq)+H2O(l) H2O(l)⇄H+(aq)+OH-(aq) NH4CH3COO(aq)+H2O(l)⇄NH4OH(aq)+CH3COOH(aq)

please balance the equation and solve the provlem with all units (aq) (s) (l) etc 3.)...

please balance the equation and solve the provlem with all units (aq) (s) (l) etc 3.) (Taken from Chemistry: A Molecular Approach, 1" Ed., by Tro) Calculate the pH of a solution that is 0.0150 M in HBr and 0.0100 M in HCIO.

Balance the equation: ____H2SO4(aq)+ ____Ba(OH)2(aq) >>> ____ H2O(l)+ ____BaSO4(s) Please Show how to solve. Thanks!